Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-메톡시프로판
2-메톡시프로판 · isopropyl methyl ether · Isopryl · Propane, 2-Methoxy- · Methyl isopropyl ether · Propane, 2-Methoxy-(9CI) · Methyl 1-methylethyl ether · VinylIsobutylEther（Assumed）
식별자 및 물리적 특성
| CAS No. | 598-53-8 |
|---|---|
| 분자식 | C4H10O |
| 평균 분자량 | 74.12 g/mol |
| 단동위원소 질량 | 74.07316494 g/mol |
| SMILES | COC(C)C |
| InChIKey | RMGHERXMTMUMMV-UHFFFAOYSA-N |
| PubChem CID | 11721 |
| ChEBI | CHEBI:53505 |
| EC No. | 209-937-1 |
| DTXSID | DTXSID50208534 |
| 현지명 | 2-메톡시프로판 |
화학 및 물리적 성질
| XLogP | 0.9 |
|---|---|
| 극성 표면적 | 9.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 5 |
| 형식 전하 | 0 |
| 복잡도 | 17.6 |
| SpringerMaterials Properties | Coriolis coupling |
| 녹는점 | -145.22°C |
| 끓는 점 | 30.75°C |
| 밀도 | 0.7140 |
| 굴절률 | 1.3576 |
| 용해도 | 에 용해됨클로로포름, 메탄올 (약간 용해됨) |
| 물리적 상태 | 기름 |
| 색상 | 무색 |
| 용해도 | 61.03g/L(25℃) |
| 비열 | Cp(liquid): 2.18 J/(g·K), at 25℃ |
| 헨리 상수 | 1.1×10-2 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| 안정성 | 매우 휘발성 |
| InChI | InChI=1S/C4H10O/c1-4(2)5-3/h4H,1-3H3 |
| InChIKey | RMGHERXMTMUMMV-UHFFFAOYSA-N |
| SMILES | CC(OC)C |
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P264, P280, P302+P352, P303+P361+P353, P321, P332+P317, P362+P364, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 13 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 기존화학 물질 | KE-21731 |
용도
용도
2-Methoxy Propane is a synthetic intermediate used for the preparation of various biosynthetic molecules and pharmaceutical goods.