Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디메틸l(2,4)-3-펜탄올
2,4-다이메틸-3-펜탄올 · 디메틸l(2,4)-3-펜탄올 · 3-Pentanol, 2,4-dimethyl- · Diisopropylcarbinol · Diisopropylmethanol · 2,4-dimethyl-3-pentano · 2,4-Dimethyl-3-pentanol · 2-4-Dimethyl-pentanol-3
식별자 및 물리적 특성
| CAS No. | 600-36-2 |
|---|---|
| 분자식 | C7H16O |
| 평균 분자량 | 116.2 g/mol |
| 단동위원소 질량 | 116.12011513 g/mol |
| SMILES | CC(C)C(O)C(C)C |
| InChIKey | BAYAKMPRFGNNFW-UHFFFAOYSA-N |
| PubChem CID | 11752 |
| ChEMBL | CHEMBL2260956 |
| EC No. | 209-993-7 |
| DTXSID | DTXSID9022075 |
| 현지명 | 디메틸l(2,4)-3-펜탄올 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 49.4 |
| Solvents | Solvents -> Alcohols (<C12) |
| SpringerMaterials Properties | Boiling point |
| LogP(분배 계수) | 2.31 |
| Physical Description | Colorless liquid[Alfa Aesar MSDS] |
| 녹는점 | -70°C |
| 끓는 점 | 139-140 °C (lit.) |
| 밀도 | 0.829 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.425(lit.) |
| 인화점 | 99 °F |
| 저장 조건 | Store at room temperature |
| pKa(산도 계수) | 15.04±0.20(Predicted) |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| 용해도 | 32.4g/L(20℃) |
| BRN | 1731593 |
| 헨리 상수 | 4.0×10-1 mol/(m3Pa) at 25℃, Yaffe et al. (2003) |
| InChI | InChI=1S/C7H16O/c1-5(2)7(8)6(3)4/h5-8H,1-4H3 |
| InChIKey | BAYAKMPRFGNNFW-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)C(C)C |
| LogP(분배 계수) | 1.899 (est) |
| NIST | 3-Pentanol, 2,4-dimethyl-(600-36-2) |
| EPA | 2,4-Dimethyl-3-pentanol (600-36-2) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P303+P361+P353, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | 2,4-Dimethyl-3-pentanol: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Causes optic nerve neuropathy in 26-week intermittent inhalation studies (mammal species not specified)Causes other degenerative changes in brain and other changes in liver and kidney in 26-week intermittent oral studies of rabbits[RTECS] An irritant[Alfa Aesar MSDS] See Methyl alcohol. |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 유해 작용 | Neurotoxin - Other CNS neurotoxin |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SA6660000 |
| 운송 번호(UN) | UN 1987 3/PG 3 |
| 관세 코드 | 29051990 |
| 위험 문구(R) | 10-22-37/38-41 |
| 위험 표시 | Xn |
| 안전 문구(S) | 16-26-39 |
| 포장분류 | III |
| 위험 등급 | 3Acute Tox. 4 OralEye Dam. 1Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| 기존화학 물질 | KE-11743 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
2,4-Dimethyl-3-pentanol was used as a proton source in the diastereoselective coupling with 2-substituted acrylate derivatives. It was used in the polymerization of 1,1′-(1,3-phenylene) diethanol (1,3-diol) and diisopropyl adipate.