Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
9-Methylacridine
Acridine, 9-methyl- · NSC 1234 · 9-Methylacridin · 9-Methylakridin · 9-METHYLACRIDINE · 9-methyl-acridin · 5-Methylacridine · 9-methylacrydine
식별자 및 물리적 특성
| CAS No. | 611-64-3 |
|---|---|
| 분자식 | C14H11N |
| 평균 분자량 | 193.24 g/mol |
| 단동위원소 질량 | 193.08914936 g/mol |
| SMILES | Cc1c2ccccc2nc2ccccc12 |
| InChIKey | FLDRLXJNISEWNZ-UHFFFAOYSA-N |
| PubChem CID | 11913 |
| ChEMBL | CHEMBL1883643 |
| EC No. | 210-272-4 |
| DTXSID | DTXSID60862287 |
화학 및 물리적 성질
| XLogP | 3.9 |
|---|---|
| 극성 표면적 | 12.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 203 |
| 용해도 | 7.9 [ug/mL] (The mean of the results at pH 7.4)클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 녹는점 | 114-119 °C |
| 끓는 점 | 319.47°C (rough estimate) |
| 밀도 | 1.1061 (rough estimate) |
| 굴절률 | 1.5850 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 6.68±0.10(Predicted) |
| 물리적 상태 | 액체 |
| 색상 | 무색의 |
| 주요 응용 | 의약품(소분자) |
| InChI | InChI=1S/C14H11N/c1-10-11-6-2-4-8-13(11)15-14-9-5-3-7-12(10)14/h2-9H,1H3 |
| InChIKey | FLDRLXJNISEWNZ-UHFFFAOYSA-N |
| SMILES | C1C2C(=NC3C(C=2C)=CC=CC=3)C=CC=1 |
화학적 성질
Yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (97.8%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (97.8%) |
| 수질 위해 등급(WGK) | WGK 3 |
| RTECS 번호 | AR9440000 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 68-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 45-36/37/39-26-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
9-Methylacridine is an derivative of Acridine (A190900), a quinoline derivative used as manufacturing dyes and as an intermediate for the synthesis of antileishmanial agents.