Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
LY2087101
LY 2087101 · (2-Amino-5-keto)thiazole) · [2-[(4-Fluorophenyl)amino]-4-methyl-5-thiazolyl]-3-thienylmethanone · Methanone, [2-[(4-fluorophenyl)amino]-4-methyl-5-thiazolyl]-3-thienyl- · [2-(4-Fluoro-phenylamino)-4-methyl-thiazol-5-yl]-thiophen-3-yl-methanone
식별자 및 물리적 특성
| CAS No. | 913186-74-0 |
|---|---|
| 분자식 | C15H11FN2OS2 |
| 평균 분자량 | 318.4 g/mol |
| 단동위원소 질량 | 318.02968349 g/mol |
| SMILES | Cc1nc(Nc2ccc(F)cc2)sc1C(=O)c1ccsc1 |
| InChIKey | PEAMDZVDNYENPN-UHFFFAOYSA-N |
| PubChem CID | 11964458 |
| EC No. | 809-683-7 |
화학 및 물리적 성질
| XLogP | 4.7 |
|---|---|
| 극성 표면적 | 98.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 377 |
| 녹는점 | 160 - 163°C |
| 끓는 점 | 449.1±55.0 °C(Predicted) |
| 밀도 | 1.407±0.06 g/cm3(Predicted) |
| 저장 조건 | Store at +4°C |
| 용해도 | DMSO: 용해성20mg/mL, 투명 |
| pKa(산도 계수) | 2.71±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 베이지색 |
| InChI | 1S/C15H11FN2OS2/c1-9-14(13(19)10-6-7-20-8-10)21-15(17-9)18-12-4-2-11(16)3-5-12/h2-8H,1H3,(H,17,18) |
| InChIKey | PEAMDZVDNYENPN-UHFFFAOYSA-N |
| SMILES | Fc1ccc(cc1)Nc2[s]c(c(n2)C)C(=O)c3c[s]cc3 |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36/37/39 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
LY 2087101 is a positive allosteric Nicotinic acetylcholine receptor (nAChR) modulators. nAChRs are found in the CNS and they respond to neurotransmitter acetylcholine.