Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
클로로(3-)벤질클로라이드
클로로(3-)벤질클로라이드 · 3-클로로벤질 클로라이드 · MCBC · AKOS BBS-00004024 · A,M-DICHLOROTOLUENE · 3,α-dichlorotoluene · à,3-dichlorotoluene · m,a-Dichlorotoluene
식별자 및 물리적 특성
| CAS No. | 620-20-2 |
|---|---|
| 분자식 | C7H6Cl2 |
| 평균 분자량 | 161.03 g/mol |
| 단동위원소 질량 | 159.98465555 g/mol |
| SMILES | ClCc1cccc(Cl)c1 |
| InChIKey | DDGRAFHHXYIQQR-UHFFFAOYSA-N |
| PubChem CID | 12103 |
| ChEMBL | CHEMBL3561692 |
| EC No. | 210-629-4 |
| DTXSID | DTXSID2057786 |
| 현지명 | 클로로(3-)벤질클로라이드 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 83 |
| SpringerMaterials Properties | Density |
| 녹는점 | 3.27°C (estimate) |
| 끓는 점 | 215-216 °C (lit.) |
| 밀도 | 1.27 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.555(lit.) |
| 인화점 | 210 °F |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| BRN | 742266 |
| InChI | InChI=1S/C7H6Cl2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| InChIKey | DDGRAFHHXYIQQR-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(CCl)=C1 |
| NIST | Benzene, 1-chloro-3-(chloromethyl)-(620-20-2) |
| EPA | Benzene, 1-chloro-3-(chloromethyl)- (620-20-2) |
화학적 성질
Colorless to light yellow liqui
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 1.4% (1 of 71) of reports.DangerH302 (25.4%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P330, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 71 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzene, 1-chloro-3-(chloromethyl)- |
| Hazard Classes and Categories | Acute Tox. 4 (25.4%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 2235 6.1/PG 3 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 34-51/53-43-36-20/21/22 |
| 위험 표시 | C,N,Xn |
| 안전 문구(S) | 26-36/37/39-45-61-14C |
| 포장분류 | III |
| 위험 등급 | 6.1Skin Corr. 1B |
| F 고인화성물질 | 19 |
| 위험 참고 사항 | Corrosive/Lachrymatory |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
3-Chlorobenzyl chloride has been used in the reaction of 3-methoxybenzyl chloride and ethyl 4-bromobenzoate in pure water, using zinc dust and a Pd catalyst.