Benzyl carbamate
Z-NH2 · CARBAM · O-Benzylcarbamate · Benzyl aminoformate · N-CARBOBENZOXY-AMIDE · CarbaMyl Benzyl Ester · CARBAMIC ACID BENZYL ESTER · Z-AMIDE
식별자 및 물리적 특성
| CAS No. | 621-84-1 |
|---|---|
| 분자식 | C8H9NO2 |
| 평균 분자량 | 151.16 g/mol |
| 단동위원소 질량 | 151.06332853 g/mol |
| SMILES | NC(=O)OCc1ccccc1 |
| InChIKey | PUJDIJCNWFYVJX-UHFFFAOYSA-N |
| PubChem CID | 12136 |
| ChEMBL | CHEMBL2259788 |
| EC No. | 210-710-4 |
| DTXSID | DTXSID00211159 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 52.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 130 |
| 녹는점 | 86-89 °C (lit.) |
| 끓는 점 | 273.17°C (rough estimate) |
| 밀도 | 1.2023 (rough estimate) |
| 굴절률 | 1.5810 (estimate) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 분말 또는 플레이크 |
| pKa(산도 계수) | 13.42±0.50(Predicted) |
| 색상 | 미색부터 밝은 베이지까지 |
| 용해도 | 68.02g/L(37℃) |
| BRN | 1865635 |
| InChI | InChI=1S/C8H9NO2/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | PUJDIJCNWFYVJX-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)N |
| NIST | Carbamic acid, benzyl ester(621-84-1) |
화학적 성질
Off-white to light beige powder or flakes, melting point 87-89 ℃. Insoluble in water, soluble in organic solvents such as benzene.
안전 및 규제
| GHS 분류 | WarningH302 (50%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (50%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29242995 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 22-24/25-36-26 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Benzyl carbamate is a reagent used for the nucleophilic introduction of an amino-protected group, Benzyl carbamates can be considered as a benzyloxycarbonyl (otherwise known as carbobenzyloxy, Cbz or Z) protecting group for amino groups. It was introduced as a versatile alternative to the ethoxy carbamate group in peptide synthesis.
제조 및 합성 방법
제조 방법
Benzyl carbamate is prepared by reacting benzyl chloroformate with ammonia. Benzyl chloroformate was slowly added to 5 times the volume of cold ammonia water (relative density 0.90) under vigorous stirring, the reaction mixture was placed at room temperature for 30 minutes, the precipitate was filtered out, washed with water and dried to obtain the finished product of benzyl carbamate.