p- 토릴 이소티오시아네이트
p-토릴이소티오시아네이트 · P-TOLYL ISOTHIOCYANATE · AKOS BBS-00004440 · TIMTEC-BB SBB008290 · 4-TOLYL ISOTHIOCYANATE · p-TolylIsothiocyanate>P-toluene isothiocyanate · p-Tolylisothiocyanate,97% · p-Tolyl isothiocyanate 97%
식별자 및 물리적 특성
| CAS No. | 622-59-3 |
|---|---|
| 분자식 | C8H7NS |
| 평균 분자량 | 149.21 g/mol |
| 단동위원소 질량 | 149.02992022 g/mol |
| SMILES | Cc1ccc(N=C=S)cc1 |
| InChIKey | ABQKHKWXTUVKGF-UHFFFAOYSA-N |
| PubChem CID | 12149 |
| ChEMBL | CHEMBL4648542 |
| EC No. | 210-745-5 |
| DTXSID | DTXSID50211240 |
| 현지명 | p- 토릴 이소티오시아네이트 |
화학 및 물리적 성질
| XLogP | 3.9 |
|---|---|
| 극성 표면적 | 44.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 141 |
| SpringerMaterials Properties | Density |
| LogP(분배 계수) | 3.9 |
| 녹는점 | 25-26 °C (lit.) |
| 끓는 점 | 237 °C (lit.) 62 °C/0.3 mmHg (lit.) |
| 밀도 | 1.1442 (rough estimate) |
| 굴절률 | n20/D 1.6345(lit.) |
| 인화점 | 107 °C |
| 저장 조건 | Store below +30°C. |
| 물리적 상태 | powder to lump |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 분해될 수 있음 |
| BRN | 386032 |
| InChI | InChI=1S/C8H7NS/c1-7-2-4-8(5-3-7)9-6-10/h2-5H,1H3 |
| InChIKey | ABQKHKWXTUVKGF-UHFFFAOYSA-N |
| SMILES | C1(N=C=S)=CC=C(C)C=C1 |
| NIST | Benzene, 1-isothiocyanato-4-methyl-(622-59-3) |
화학적 성질
clear light yellow liquid after melting
안전 및 규제
| GHS 분류 | DangerH302 (12.8%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P261, P264, P264+P265, P270, P271, P272, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P333+P317, P337+P317, P342+P316, P362+P364, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (12.8%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | NX9500000 |
| 운송 번호(UN) | UN 2811 6.1/PG 2 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 36/37/38-42-42/43-23/24/25 |
| 위험 표시 | Xn,T |
| 안전 문구(S) | 22-26-36-45-36/37/39 |
| 포장분류 | III |
| 위험 등급 | 6.1Eye Irrit. 2Resp. Sens. 1Skin Irrit. 2Skin Sens. 1STOT SE 3 |
| F 고인화성물질 | 10-21 |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
p-Tolyl isothiocyanate has been used in the preparation of 6-[1-amino-3-(p-tolyl)-thiourea]-2-ethylbenzo[de]isoquinoline-1,3-dione. It is used as capping agent to cap the N-terminal ends of polypeptide. It is also used as pharmaceutical intermediate.
일반 설명
p-Tolyl isothiocyanate reacts with 6-hydroxy-2,4,5-triaminopyrimidine or with 4,5,6-triaminopyrimidine in DMF and triethylamine to yield 2,4-diamino-5-(p-tolylthioureido)aminopyrimidin-6-one and 4,6-diamino-5-(tolylthioureido)aminopyrimidine, respectively.