Benzene, 1,3-diiodo-
M-DIIODOBENZENE · 1,3-diiodo-benzen · Benzene,m-diiodo- · 1,3-Diiodobenzene · Benzene, m-diiodo- · benzene,1,3-diiodo- · Benzene, 1,3-diiodo- · 1,3-Diiodobenzene >1,3-Phenylene diiodide
식별자 및 물리적 특성
| CAS No. | 626-00-6 |
|---|---|
| 분자식 | C6H4I2 |
| 평균 분자량 | 329.9 g/mol |
| 단동위원소 질량 | 329.84024613 g/mol |
| SMILES | Ic1cccc(I)c1 |
| InChIKey | SFPQFQUXAJOWNF-UHFFFAOYSA-N |
| PubChem CID | 12270 |
| EC No. | 210-921-1 |
| DTXSID | DTXSID9060811 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 64.9 |
| SpringerMaterials Properties | Crystal structure |
| 녹는점 | 34-37 °C (lit.) |
| 끓는 점 | 285°C |
| 밀도 | 2.47 |
| 굴절률 | 1.7179 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름, 메탄올(약간 가열) 에 용해됨 |
| 물리적 상태 | 저융점 결정질 덩어리, 분말 또는 결정 |
| 색상 | 노란색에서 베이지색 |
| 용해도 | 물에 불용성. 뜨거운 메탄올에 용해됩니다. |
| BRN | 1904540 |
| InChI | InChI=1S/C6H4I2/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | SFPQFQUXAJOWNF-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=CC(I)=C1 |
| EPA | Benzene, 1,3-diiodo- (626-00-6) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1,3-Diiodobenzene may be used in the synthesis of:3,5-bis(perfluorodecyl)phenylboronic acidepitaxially aligned and separated polyphenylene lines on Cu(110)1,3-bis(4-ethynyl-2,5-dibutoxyphenyl-1-ethynyl)benzene
일반 설명
1,3-Diiodobenzene is a halogenated benzene derivative. Its reaction with phenylboronic acid in the presence of CuI, DABCO (1,4-diazabicyclo[2.2.2]octane) and TBAB (n-Bu4NBr) has been analyzed. 1,3-Diiodobenzene undergoes coupling with 2-methylthiophene in the presence of Ir/Ag2CO3 to afford meta-linked isomer of thiophene-benzene-thiophene triad.