Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl 6-chloropyridazine-3-carboxylate
KML-38 · CML-037 · AKOS 91997 · TERT-BUTYL 4-(2-AM... · Methyl 3-chloropyridazine... · 6-Chloro-3-(methoxycarbonyl)pyridazine · Methyl 6-chloropyridazine-3-carboxylate · Methyl 3-chloropyridazine-6-carboxylate
식별자 및 물리적 특성
| CAS No. | 65202-50-8 |
|---|---|
| 분자식 | C6H5ClN2O2 |
| 평균 분자량 | 172.57 g/mol |
| 단동위원소 질량 | 172.00395508 g/mol |
| SMILES | COC(=O)c1ccc(Cl)nn1 |
| InChIKey | FPKXYXKLOWAIOX-UHFFFAOYSA-N |
| PubChem CID | 12379801 |
| EC No. | 691-623-2 |
| DTXSID | DTXSID10495387 |
화학 및 물리적 성질
| XLogP | -0.2 |
|---|---|
| 극성 표면적 | 52.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 154 |
| 녹는점 | 145 °C(Solv: ligroine (8032-32-4)) |
| 끓는 점 | 310.9±22.0 °C(Predicted) |
| 밀도 | 1.372±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | -1.06±0.10(Predicted) |
| 색상 | 회색 |
| InChI | InChI=1S/C6H5ClN2O2/c1-11-6(10)4-2-3-5(7)9-8-4/h2-3H,1H3 |
| InChIKey | FPKXYXKLOWAIOX-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NN=C(Cl)C=C1 |
화학적 성질
Solid
안전 및 규제
| GHS 분류 | WarningH302 (60%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (60%) |
| 관세 코드 | 29335990 |
| 위험 표시 | Xi |
| 위험 등급 | IRRITANT |