Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디클로로에틸에틸에테르
디클로로에틸에틸에테르 · 2,6-DiMethybenzoic acid · VIC-M-XYLYLIC ACID · RARECHEM AL BO 0401 · TIMTEC-BB SBB007881 · 2,6-dimethyl-benzoicaci · 2,6－dimetnylbenzoic acid · 2,6-DIMETHYLBENZOIC ACID
식별자 및 물리적 특성
| CAS No. | 632-46-2 |
|---|---|
| 분자식 | C9H10O2 |
| 평균 분자량 | 150.17 g/mol |
| 단동위원소 질량 | 150.06807956 g/mol |
| SMILES | Cc1cccc(C)c1C(=O)O |
| InChIKey | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| PubChem CID | 12439 |
| ChEBI | CHEBI:64827 |
| EC No. | 211-177-0 |
| DTXSID | DTXSID10212551 |
| 현지명 | 디클로로에틸에틸에테르 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 144 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP(분배 계수) | 2.21 |
| 녹는점 | 114-116 °C (lit.) |
| 끓는 점 | 160 °C / 17mmHg |
| 밀도 | 1.0937 (estimate) |
| 굴절률 | 1.5236 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | pKa: 3.362(25°C) |
| 색상 | 흰색에서 연한 크림색 |
| BRN | 1863791 |
| InChI | InChI=1S/C9H10O2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(C)C=CC=C1C |
| LogP(분배 계수) | 2.210 |
| NIST | Benzoic acid, 2,6-dimethyl-(632-46-2) |
화학적 성질
white to pale cream crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzoic acid, 2,6-dimethyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DG8734010 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2,6-Dimethylbenzoic acid is a benzoic acid derivative used in the preparation of antiinflammatory and antirheumatic agents. And it is also a potential geothermal tracer.
일반 설명
Crystal structure of 2,6-dimethylbenzoic acid was studied by three-dimensional X-ray methods.