N-((9H-Fluoren-9-ylmethoxy)carbonyl)-S-(triphenylmethyl)-L-cysteine
FMOC-CYS(TRT)-OH · FMOC-CYS(TRT) · FMOC-L-CYS(TRT)-OH · Fomc-Cys(Trt)-OH · N-FMOC-S-TRITYL-L-CYSTEINE · Fmoc-Cyc(Trt)-OH · FMOC-L-CYS(TRT) · Fmoc-Cys(Trt)-0H
식별자 및 물리적 특성
| CAS No. | 103213-32-7 |
|---|---|
| 분자식 | C37H31NO4S |
| 평균 분자량 | 585.7 g/mol |
| 단동위원소 질량 | 585.19737947 g/mol |
| SMILES | O=C(N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChIKey | KLBPUVPNPAJWHZ-UMSFTDKQSA-N |
| PubChem CID | 128239 |
| ChEMBL | CHEMBL396414 |
| EC No. | 600-408-4 |
| DTXSID | DTXSID70145699 |
화학 및 물리적 성질
| XLogP | 8 |
|---|---|
| 극성 표면적 | 101 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 11 |
| 무거운 원자 수 | 43 |
| 형식 전하 | 0 |
| 복잡도 | 841 |
| 물질 분류 | Biological Agents -> Amino Acids and Derivatives |
| Physical Description | Beige powder[Sigma-Aldrich MSDS] |
| 녹는점 | 170-173 °C(lit.) |
| 끓는 점 | 763.4±60.0 °C(Predicted) |
| 밀도 | 1.270±0.06 g/cm3(Predicted) |
| 굴절률 | 18 ° (C=1, THF) |
| 저장 조건 | 2-8°C |
| 용해도 | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pKa(산도 계수) | 3.70±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 물에 불용성. 대부분의 유기용매에 용해됩니다. |
| BRN | 4221286 |
| 주요 응용 | 펩타이드 합성 |
| InChIKey | KLBPUVPNPAJWHZ-UMSFTDKQSA-N |
| SMILES | OC(=O)[C@H](CSC(c1ccccc1)(c2ccccc2)c3ccccc3)NC(=O)OCC4c5ccccc5-c6ccccc46 |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 42.9% (3 of 7) of reports.WarningH302 (14.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | May cause irritation[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Skin Irrit. 2 (57.1%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-26 |
| F 고인화성물질 | 9-21 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
FMOC-S-trityl-L-cysteine is potentially useful for proteomics studies, and solid phase peptide synthesis techniques. The compound could be useful as an unusual amino acid analog to aid in the deconvolution of protein structure and function.
일반 설명
The standard derivative for Fmoc SPPS of peptides containing Cys [1]. The Trt group is removed with 95% TFA containing 1-5% TIS. Ideally, this derivative should be introduced using the symmetrical anhydride or DIPCDI/HOBt activation [2,3] to minimize enantiomerization. If activation with uronium or phosphonium reagents, such as HBTU or PyBOP®, is to be employed, it is strongly recommended that collidine is used as the base [4], as this has been shown to significantly reduce loss of optical integrity during coupling.