Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
6-Nitro-1,3-benzodioxole-5-carboxaldehyde
6-Nitrobenzo[d][1,3]dioxole-5-carbaldehyde · NSC 40550 · NSC 66217 · 6-nitro-piperona · 6-Nitropiperonal · AKOS BBS-00006440 · TIMTEC-BB SBB000335 · Piperonal, 6-nitro-
식별자 및 물리적 특성
| CAS No. | 712-97-0 |
|---|---|
| 분자식 | C8H5NO5 |
| 평균 분자량 | 195.13 g/mol |
| 단동위원소 질량 | 195.01677226 g/mol |
| SMILES | O=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChIKey | NRZWECORTTWSEF-UHFFFAOYSA-N |
| PubChem CID | 12840 |
| EC No. | 211-926-1 |
| DTXSID | DTXSID50221400 |
화학 및 물리적 성질
| XLogP | 1 |
|---|---|
| 극성 표면적 | 81.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 251 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 93-94 °C (lit.) |
| 끓는 점 | 331.78°C (rough estimate) |
| 밀도 | 1.5671 (rough estimate) |
| 굴절률 | 1.5282 (estimate) |
| 저장 조건 | Hygroscopic, Refrigerator, under inert atmosphere |
| 용해도 | DMSO(약간), 에탄올(약간, 가열)에 용해됨 |
| 물리적 상태 | 미세 결정성 분말 |
| 색상 | 노란색 |
| BRN | 384010 |
| InChI | InChI=1S/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
| InChIKey | NRZWECORTTWSEF-UHFFFAOYSA-N |
| SMILES | O1C2=CC([N+]([O-])=O)=C(C=O)C=C2OC1 |
화학적 성질
Yellow Solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DF4912750 |
| 관세 코드 | 29329990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 37/39-26-37 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
6-Nitropiperonal was used to study the mechanism of aromatic nucleophilic substitution reaction of [18F]Fluoride ion. It was used in the synthesis of 6-[18F]fluoro-L-dopa.