Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-나이트로페닐 아세트산
4-나이트로페닐아세트산 · 4-니트로페닐아세테이트 · P-NITROPHENYL ACETATE · 4-Nitropheyl acetate · NSC 2633 · p-nitrophenyl · 4-Nitrophenylacetat · p-Acetoxynitrobenzen
식별자 및 물리적 특성
| CAS No. | 830-03-5 |
|---|---|
| 분자식 | C8H7NO4 |
| 평균 분자량 | 181.15 g/mol |
| 단동위원소 질량 | 181.0375077 g/mol |
| SMILES | CC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChIKey | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| PubChem CID | 13243 |
| ChEMBL | CHEMBL40988 |
| ChEBI | CHEBI:82635 |
| EC No. | 212-593-5 |
| DTXSID | DTXSID2061191 |
| 현지명 | 4-나이트로페닐 아세트산 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 72.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 203 |
| 물질 분류 | Nitrogen Compounds -> Other Aromatics (Nitrogen) |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP(분배 계수) | 1.5 |
| 증기압 | 0.00186 [mmHg]1.28Pa at 20℃ |
| Physical Description | White crystalline solid[Alfa Aesar MSDS] |
| 녹는점 | 75-77 °C (lit.) |
| 끓는 점 | 314.24°C (rough estimate) |
| 밀도 | 1.4283 (rough estimate) |
| 굴절률 | 1.5468 (estimate) |
| 저장 조건 | -20°C |
| 용해도 | 0.53g/L |
| 물리적 상태 | 가루 |
| 색상 | 녹색 |
| 용해도 | 물에 불용성. |
| BRN | 515874 |
| 안정성 | 안정적인. 타기 쉬운. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| InChIKey | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1ccc(cc1)OC(=O)C |
| LogP(분배 계수) | 1.58 at 25℃ and pH6.83 |
| EPA | Acetic acid, 4-nitrophenyl ester (830-03-5) |
화학적 성질
off-white or beige powder
안전 및 규제
| GHS 분류 | DangerH272 (100%): May intensify fireoxidizer [Danger Oxidizing liquidsOxidizing solids]P210, P220, P261, P264+P265, P272, P280, P302+P352, P305+P354+P338, P317, P321, P333+P317, P362+P364, P370+P378, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Acetic acid, 4-nitrophenyl esterStatus: Active Update: 12-04-2016 https://echa.europa.eu/registration-dossier/-/registered-dossier/17205Acetic acid, 4-nitrophenyl ester: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Intravenous LD50 (mouse) = 180 mg/kg[RTECS] May cause irritation[Alfa Aesar MSDS] See Phenyl acetate. See Nitrobenzene. |
| Hazard Classes and Categories | Ox. Sol. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | AJ1150000 |
| 독성 | LD50 ivn-mus: 180 mg/kg CSLNX* NX#00217 |
| 관세 코드 | 29153900 |
| 위험 문구(R) | 11-34 |
| 위험 표시 | F,C |
| 안전 문구(S) | 24/25-45-36/37/39-26-16 |
| 기존화학 물질 | KE-00056 |
| 위험 등급 | Eye Dam. 1Ox. Sol. 3Skin Sens. 1 |
| 저장 분류 | 5.1B - Oxidizing hazardous materials |
용도
용도
4-Nitrophenyl Acetate have been used as a substrate to study for the enzymatic activity of Carbonic Anhydrase III isolated from bovine skeletal muscle.