1-[[(9H-플로렌-9-일메톡시)카보닐]옥시]-2,5-필롤리딘디온
1-[[(9H-플로렌-9-일메톡시)카보닐]옥시]-2,5-필롤리딘디온(CASNo.82911-69-1) · 1-[[(9H-플로렌-9-일메톡시)카보닐]옥시]-2,5-필롤리딘디온 · FMOC-OSU · Fomc-Osu · (9H-Fluoren-9-yl)Methyl (2,5-dioxopyrrolidin-1-yl) carbonate · FMOC-SU · N-(9-FLUORENYLMETHOXYCARBONYLOXY)SUCCINIMIDE · FMOC N-HYDROXYSUCCINIMIDE ESTER
![1-[[(9H-플로렌-9-일메톡시)카보닐]옥시]-2,5-필롤리딘디온 분자 구조식](/img/chemical/134122.png)
식별자 및 물리적 특성
| CAS No. | 82911-69-1 |
|---|---|
| 분자식 | C19H15NO5 |
| 평균 분자량 | 337.3 g/mol |
| 단동위원소 질량 | 337.09502258 g/mol |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)ON1C(=O)CCC1=O |
| InChIKey | WMSUFWLPZLCIHP-UHFFFAOYSA-N |
| PubChem CID | 134122 |
| EC No. | 433-520-5 |
| DTXSID | DTXSID90232090 |
| 현지명 | 1-[[(9H-플로렌-9-일메톡시)카보닐]옥시]-2,5-필롤리딘디온 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 72.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 25 |
| 형식 전하 | 0 |
| 복잡도 | 524 |
| 녹는점 | 150-153 °C(lit.) |
| 끓는 점 | 150-153°C |
| 밀도 | 1.3460 (rough estimate) |
| 굴절률 | 1.5000 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 디메틸 설폭시드 및 디메틸 포름아미드에 용해됩니다. |
| 물리적 상태 | 초미립자 분말 |
| 색상 | 흰색 또는 거의 흰색 |
| BRN | 3569540 |
| 안정성 | 수분에 민감한 |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C19H15NO5/c21-17-9-10-18(22)20(17)25-19(23)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2 |
| InChIKey | WMSUFWLPZLCIHP-UHFFFAOYSA-N |
| SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)ON1C(=O)CCC1=O |
화학적 성질
White powder
안전 및 규제
| GHS 분류 | WarningH302: Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P272, P273, P280, P301+P317, P302+P352, P321, P330, P333+P317, P362+P364, P391, and P501 (click each P-code to see the statement)H302 (98.8%): Harmful if swallowed [Warning Acute toxicity, oral] |
|---|---|
| 규제 정보 | Status: Active Update: 29-11-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/139242,5-Pyrrolidinedione, 1-(9H-fluoren-9-ylmethoxy)carbonyloxy-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (100%)Acute Tox. 4 (98.8%)Acute toxicity - category 4Acute Tox. 4 * |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3077 9 / PGIII |
| 관세 코드 | 29251995 |
| 위험 문구(R) | 36/37/38-51/53-43-22 |
| 위험 표시 | Xi,N,Xn |
| 안전 문구(S) | 22-24/25-26/37/39-26-61-37-24 |
| 위험 등급 | 9Acute Tox. 4 OralAquatic Chronic 2Skin Sens. 1 |
| 기존화학 물질 | 2001-3-1751 |
| F 고인화성물질 | 10-21 |
| 위험 참고 사항 | Moisture Sensitive |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
Fmoc-OSu (N-(9-Fluorenylmethoxycarbonyloxy)succinimide) is a reagent used in solid-phase peptide synthesis (SPPS) for Fmoc protection of amino groups, particularly amino acids. This reagent contains an Fmoc functional group, which is stable under acidic conditions and cleaves under alkaline conditions. Fmoc-OSu reacts with amino groups to form stable amide bonds, helping to reduce the occurrence of side reactions. Additionally, Fmoc-OSu can also be used as a fluorescent reagent.
용도
N-(9-Fluorenylmethoxycarbonyloxy)succinimide is used in conjunction with Isothiocyanate to conduct partial Edman Degradation on biologically active peptides.