Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-아세틸-1-사이클로헥센
1-아세틸-1-사이클로헥센 · Ethanone, 1-(1-cyclohexen-1-yl)- · 1-Acetylcyclohexene · 1-Cyclohexenyl methyl ketone · 1-(1-Cyclohexen-1-yl)ethanone · 1-(cyclohex-1-en-1-yl)ethanone · 1-Cyclohexen-1-yl methyl ketone · Ketone, 1-cyclohexen-1-yl methyl
식별자 및 물리적 특성
| CAS No. | 88449-93-8 |
|---|---|
| 분자식 | C8H12O |
| 평균 분자량 | 124.18 g/mol |
| 단동위원소 질량 | 124.088815 g/mol |
| SMILES | CC(=O)C1=CCCCC1 |
| InChIKey | LTYLUDGDHUEBGX-UHFFFAOYSA-N |
| PubChem CID | 13612 |
| ChEMBL | CHEMBL5279035 |
| EC No. | 213-256-5 |
| DTXSID | DTXSID50862478 |
| 현지명 | 1-아세틸-1-사이클로헥센 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 145 |
| 물질 분류 | Other Classes -> Aliphatic Ketones, Other |
| SpringerMaterials Properties | Optical coefficient |
| Physical Description | Clear yellow liquid[Sigma-Aldrich MSDS] |
| 녹는점 | 73 °C |
| 끓는 점 | 201-202 °C(lit.) |
| 밀도 | 0.966 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.49(lit.) |
| 인화점 | 150 °F |
| 저장 조건 | Storage temp. 2-8°C |
| 물리적 상태 | 액체 |
| 색상 | 약간 노란색으로 맑음 |
| InChI | InChI=1S/C8H12O/c1-7(9)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
| InChIKey | LTYLUDGDHUEBGX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1CCCCC=1)C |
| LogP(분배 계수) | 1.648 (est) |
화학적 성질
CLEAR SLIGHTLY YELLOW LIQUID
안전 및 규제
| GHS 분류 | WarningH227 (100%): Combustible liquid [Warning Flammable liquids]P210, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| 유해성 요약 | May cause irritation[Sigma-Aldrich MSDS] See Acetophenone. See Cyclohexanone. |
| Hazard Classes and Categories | Flam. Liq. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29142990 |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 10 - Combustible liquids |