Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bromo-5-nitrobenzotrifluoride
2-Bromo-5-nitrobenzo · Alvocidib Impurity 32 · LABOTEST-BB LT01143236 · Bicalutamide Impurity 5 · Bicalutamide Impurity 3 · Bicalutamide Impurity 10 · Bicalutamide Impurity 20 · 2-Bromo-5-nitrobenzotrifluorid
식별자 및 물리적 특성
| CAS No. | 367-67-9 |
|---|---|
| 분자식 | C7H3BrF3NO2 |
| 평균 분자량 | 270 g/mol |
| 단동위원소 질량 | 268.9299251 g/mol |
| SMILES | O=[N+]([O-])c1ccc(Br)c(C(F)(F)F)c1 |
| InChIKey | SXEQQBBOAMHOID-UHFFFAOYSA-N |
| PubChem CID | 136198 |
| EC No. | 609-288-8 |
| DTXSID | DTXSID80190150 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 228 |
| 녹는점 | 41-44 °C (lit.) |
| 끓는 점 | 87-88 °C/3 mmHg (lit.) |
| 밀도 | 1.7750 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to crystal |
| 색상 | White to Light yellow to Green |
| BRN | 2460260 |
| InChI | InChI=1S/C7H3BrF3NO2/c8-6-2-1-4(12(13)14)3-5(6)7(9,10)11/h1-3H |
| InChIKey | SXEQQBBOAMHOID-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C([N+]([O-])=O)C=C1C(F)(F)F |
화학적 성질
yellow crystals
안전 및 규제
| GHS 분류 | WarningH302+H312+H332 (16.7%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2306 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 37/39-26-24/25 |
| 위험 등급 | IRRITANT |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Bromo-5-nitrobenzotrifluoride may be used in the preparation of:new unsymmetrical diamine monomer containing both the benzimidazole ring and trifluoromethyl group, 6,4′-diamino-2′-trifluoromethyl-2-phenylbenzimidazole2,5-bis[(4-nitro-2-trifluoromethylphenoxy)-phenyl]diphenylphosphine oxide (BNTFDPO)