Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Fluoro-2-methylphenol
4-FLUORO-O-CRESOL · 4-Fluoro-2-methylphe · 4-Fluoro-o-cresol>4-Fluoro-o-methylphenol · 4-FLUORO-2-METHYLPHENOL · 2-METHYL-4-FLUOROPHENOL · 4-Fuoro-2-Methyl-phenol · 5-Fluoro-2-hydroxytoluene · 4-Fluoro-2-methylphenol99%
식별자 및 물리적 특성
| CAS No. | 452-72-2 |
|---|---|
| 분자식 | C7H7FO |
| 평균 분자량 | 126.13 g/mol |
| 단동위원소 질량 | 126.04809306 g/mol |
| SMILES | Cc1cc(F)ccc1O |
| InChIKey | GKQDDKKGDIVDAG-UHFFFAOYSA-N |
| PubChem CID | 136295 |
| ChEMBL | CHEMBL224550 |
| EC No. | 624-166-4 |
| DTXSID | DTXSID90196426 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 94.9 |
| 녹는점 | 37-38 °C (lit.) |
| 끓는 점 | 87 °C/14 mmHg (lit.) |
| 밀도 | 1.1514 (estimate) |
| 굴절률 | 1.5155-1.5175 |
| 인화점 | 185 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| pKa(산도 계수) | 10.32±0.18(Predicted) |
| 물리적 상태 | 저융점 고체 또는 액체 |
| 색상 | 황백색에서 갈색을 띤다 |
| 용해도 | 물에 불용성. |
| BRN | 2041490 |
| 주요 응용 | 환경 |
| InChI | InChI=1S/C7H7FO/c1-5-4-6(8)2-3-7(5)9/h2-4,9H,1H3 |
| InChIKey | GKQDDKKGDIVDAG-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1C |
화학적 성질
Off-white to brownish low melting solid or liquid
안전 및 규제
| GHS 분류 | WarningH302 (14.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (14.3%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1325 4.1/PG 2 |
| 관세 코드 | 29081990 |
| 위험 문구(R) | 36/37/38-21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36/37/39 |
| 위험 등급 | 8Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Fluoro-2-methylphenol is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields.
일반 설명
Laccase mediated grafting of 4-fluoro-2-methylphenol with lignin model compound, dibenzodioxocin and lignocellulose material has been investigated.