Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-브로모-4-프로필벤젠
1-브로모-4-프로필벤젠 · 1-Bromo-4-propyL · 4-broMidewascuMene · Propyl bromobenzene · P-BROMOPROPYLBENZENE · 1-Bromo-4-propylbenz · 1-Brom-4-propylbenzol · 4-propyl bromobenzene
식별자 및 물리적 특성
| CAS No. | 588-93-2 |
|---|---|
| 분자식 | C9H11Br |
| 평균 분자량 | 199.09 g/mol |
| 단동위원소 질량 | 198.00441245 g/mol |
| SMILES | CCCc1ccc(Br)cc1 |
| InChIKey | NUPWGLKBGVNSJX-UHFFFAOYSA-N |
| PubChem CID | 136374 |
| EC No. | 454-790-0 |
| DTXSID | DTXSID80207530 |
| 현지명 | 1-브로모-4-프로필벤젠 |
화학 및 물리적 성질
| XLogP | 4.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 82.7 |
| SpringerMaterials Properties | Density |
| 녹는점 | -41.4°C |
| 끓는 점 | 225 °C(lit.) |
| 밀도 | 1.286 g/mL at 25 °C(lit.) |
| 증기압 | 4.7Pa at 25℃ |
| 굴절률 | n20/D 1.537(lit.) |
| 인화점 | 203 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 액체 |
| 색상 | 무색투명~미황색 |
| 비중 | 1.286 |
| 용해도 | 2.867mg/L at 20℃ |
| InChI | InChI=1S/C9H11Br/c1-2-3-8-4-6-9(10)7-5-8/h4-7H,2-3H2,1H3 |
| InChIKey | NUPWGLKBGVNSJX-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(CCC)C=C1 |
| LogP(분배 계수) | 4.9 at 25℃ |
화학적 성질
Clear colorless to slightly yellow liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.Danger |
|---|---|
| 규제 정보 | Status: Active Update: 11-09-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/22816 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29036990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Aquatic Acute 1Aquatic Chronic 1Eye Dam. 1Skin Irrit. 2 |
| 저장 분류 | 10 - Combustible liquids |
용도
개요
1-Bromo-4-propylbenzene is an aliphatic hydrocarbon compound containing a bromine functional group in its structure. This feature is crucial for its role in chemical reactions for synthesising other complex structures. 1-Bromo-4-propylbenzene can be used to prepare cyclopalladium catalysts.
용도
Intermediates of Liquid Crystals