Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,3,5-트리메틸아다만탄
1,3,5-트리메틸아다만탄 · (1s,3s,5s)-1,3,5-trimethyladamantane · 1,3,5-triMethyladaMantan · 1,3,5-Trimethyladamantane · 1,3,5 TRIMETHYL ADMANTANE · 1,3,5-Trimethyladamentane · 1,3,5-Trimethyladamantane,95% · 1,3,5-Trimethyladamantane in isooctane
식별자 및 물리적 특성
| CAS No. | 707-35-7 |
|---|---|
| 분자식 | C13H22 |
| 평균 분자량 | 178.31 g/mol |
| 단동위원소 질량 | 178.1721507 g/mol |
| SMILES | CC12CC3CC(C)(C1)CC(C)(C3)C2 |
| InChIKey | WCACLGXPFTYVEL-UHFFFAOYSA-N |
| PubChem CID | 136552 |
| EC No. | 815-982-3 |
| DTXSID | DTXSID80220966 |
| 현지명 | 1,3,5-트리메틸아다만탄 |
화학 및 물리적 성질
| XLogP | 5 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 196 |
| 끓는 점 | 88.0-89.5 °C(Press: 19 Torr) |
| 밀도 | 0.970±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 에 용해됨클로로포름, 메탄올 (약간 용해됨) |
| 물리적 상태 | 기름 |
| 색상 | 투명 무색 |
| InChI | InChI=1S/C13H22/c1-11-4-10-5-12(2,7-11)9-13(3,6-10)8-11/h10H,4-9H2,1-3H3 |
| InChIKey | WCACLGXPFTYVEL-UHFFFAOYSA-N |
| SMILES | C12(C)CC3(C)CC(CC(C)(C3)C1)C2 |
화학적 성질
Clear Colourless Oil
안전 및 규제
| GHS 분류 | Not Classified |
|---|---|
| Hazard Classes and Categories | Not Classified |
| 위험 등급 | IRRITANT |
용도
용도
1,3,5-Trimethyladamantane is an alkyladamantane derivative that are biotransformed via strains of Pseudomonas. It is used to study alkyladamantane adsorption on graphitized thermal carbon black.