Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,2,2-트리플루오로-3'-(트리플루오로메틸)아세토페논
2,2,2-트리플루오로-3'-(트리플루오로메틸)아세토페논 · 3-Trifluoromethyltrifluoroacetophenone · 3-TRIFLUOROMETHYL-A,A,A-TRIFLUOROACETOPHENONE · 2,2,2-Trifluoro-(trifluoroMethyl)acetophenone · 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone · 3-(Trifluoromethyl)phenyl(trifluoromethyl) ketone · 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone97% · 2,2,2-TRIFLUORO-1-(3-TRIFLUOROMETHYLPHENYL)ETHANONE
식별자 및 물리적 특성
| CAS No. | 721-37-9 |
|---|---|
| 분자식 | C9H4F6O |
| 평균 분자량 | 242.12 g/mol |
| 단동위원소 질량 | 242.01663407 g/mol |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChIKey | MDCHHRZBYSSONX-UHFFFAOYSA-N |
| PubChem CID | 136559 |
| ChEMBL | CHEMBL86546 |
| EC No. | 625-956-1 |
| DTXSID | DTXSID00222422 |
| 현지명 | 2,2,2-트리플루오로-3'-(트리플루오로메틸)아세토페논 |
화학 및 물리적 성질
| XLogP | 3.6 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 266 |
| 녹는점 | 76-77 °C |
| 끓는 점 | 65-67 °C24 mm Hg(lit.) |
| 밀도 | 1.418 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.415(lit.) |
| 인화점 | 139 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 액체 |
| 색상 | Clear, almost colourless (hint of peach) |
| InChI | 1S/C9H4F6O/c10-8(11,12)6-3-1-2-5(4-6)7(16)9(13,14)15/h1-4H |
| InChIKey | MDCHHRZBYSSONX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)c1cccc(c1)C(F)(F)F |
안전 및 규제
| GHS 분류 | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1224 3/PG 3 |
| 관세 코드 | 2914790090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 포장분류 | III |
| 위험 등급 | 3.2Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant/Lachrymator |
| 저장 분류 | 3 - Flammable liquids |
용도
일반 설명
Preparation of 2,2,2-trifluoro-3′-(trifluoromethyl)acetophenone (3-trifluoromethyltrifluoroacetophenone) by Grignard synthesis using m-trifluoromethylbromo-benzene and trifluoroacetic acid has been reported.