Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4,4-다이메틸-2-사이클로헥센-1-온
4,4-다이메틸-2-사이클로헥센-1-온 · 4,4-Dimethylcyclohex-2-en-1-one · 2-Cyclohexen-1-one, 4,4-dimethyl- · 4,4-Dimethylcyclohexenone · 4,4-Dimethyl-2-cyclohexenone · 6,6-Dimethylcyclohexen-3-one · 4,4-Dimethylcyclohex-2-enone · 3,3-Dimethylcyclohexene-6-one
식별자 및 물리적 특성
| CAS No. | 1073-13-8 |
|---|---|
| 분자식 | C8H12O |
| 평균 분자량 | 124.18 g/mol |
| 단동위원소 질량 | 124.088815 g/mol |
| SMILES | CC1(C)C=CC(=O)CC1 |
| InChIKey | HAUNPYVLVAIUOO-UHFFFAOYSA-N |
| PubChem CID | 136839 |
| EC No. | 672-151-6 |
| DTXSID | DTXSID70147996 |
| 현지명 | 4,4-다이메틸-2-사이클로헥센-1-온 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 154 |
| 끓는 점 | 72-73.5 °C20 mm Hg(lit.) |
| 밀도 | 0.944 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.473(lit.) |
| 인화점 | 148 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 액체 |
| 비중 | 0.944 |
| 색상 | 클리어 다크 브라운 |
| InChI | InChI=1S/C8H12O/c1-8(2)5-3-7(9)4-6-8/h3,5H,4,6H2,1-2H3 |
| InChIKey | HAUNPYVLVAIUOO-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC(C)(C)C=C1 |
| LogP(분배 계수) | 1.480 (est) |
화학적 성질
CLEAR DARK BROWN LIQUID
안전 및 규제
| GHS 분류 | WarningH227 (16.7%): Combustible liquid [Warning Flammable liquids]P210, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 4 (16.7%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29142990 |
| 위험 문구(R) | 36-20/21/22 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36/37/39-26 |
| 저장 분류 | 10 - Combustible liquids |