디 페닐 실란 디올
디페닐실란디올 · DPSD · DIHYDROXYDIPHENYLSILANE · Diphenyldihydroxysilane · DK957 · Z-6047 · DPDHSi · CD6150
식별자 및 물리적 특성
| CAS No. | 947-42-2 |
|---|---|
| 분자식 | C12H12O2Si |
| 평균 분자량 | 216.31 g/mol |
| 단동위원소 질량 | 216.06065615 g/mol |
| SMILES | O[Si](O)(c1ccccc1)c1ccccc1 |
| InChIKey | OLLFKUHHDPMQFR-UHFFFAOYSA-N |
| PubChem CID | 13693 |
| EC No. | 213-427-4 |
| DTXSID | DTXSID3061340 |
| 현지명 | 디 페닐 실란 디올 |
화학 및 물리적 성질
| 극성 표면적 | 40.5 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 174 |
| 물질 분류 | Metals -> Metalloid Compounds (Silicon) |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| Physical Description | White powder[Aldrich MSDS] |
| 녹는점 | 144-147 °C |
| 끓는 점 | 353°C [760mmHg] |
| 밀도 | 0.87 |
| 증기 밀도 | >1 (vs air) |
| 증기압 | 0Pa at 25℃ |
| 인화점 | 129 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 12.06±0.53(Predicted) |
| 색상 | 하얀색 |
| 용해도 | 물과 반응 |
| BRN | 2523445 |
| 안정성 | 안정적인. 타기 쉬운. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C12H12O2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | OLLFKUHHDPMQFR-UHFFFAOYSA-N |
| SMILES | O[Si](O)(c1ccccc1)c2ccccc2 |
| LogP(분배 계수) | 2 at 20℃ |
| NIST | Diphenyl silanediol(947-42-2) |
| EPA | Silanediol, diphenyl- (947-42-2) |
화학적 성질
White powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 6.1% (5 of 82) of reports.DangerH228 (64.6%): Flammable solid [Danger Flammable solids]P210, P240, P241, P273, P280, P370+P378, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 82 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Silanediol, diphenyl-REACH registered substance: Diphenylsilanediol (EC: 213-427-4) |
| 유해성 요약 | Highly flammableMay cause irritation[Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Sol. 2 (64.6%) |
| 수질 위해 등급(WGK) | 1 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | VV3640000 |
| 운송 번호(UN) | UN 1325 4.1/PG 3 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 11-10 |
| 위험 표시 | F |
| 안전 문구(S) | 16-22-24/25-37-26 |
| 포장분류 | III |
| 위험 등급 | 4.1Flam. Sol. 1 |
| 기존화학 물질 | KE-12100 |
| 저장 분류 | 4.1B - Flammable solid hazardous materials |
용도
개요
Diphenylsilanediol is a chemical compound that is used as a catalyst. It can be produced by the reaction of diphenylsilane with sulfuric acid. This chemical has been shown to have high thermal and chemical stability, making it an ideal material for catalytic materials. Diphenylsilanediol has also been shown to be an efficient solid catalyst for synthesizing hydrocarbons from hydrogen fluoride and hydrochloric acid. The efficiency of this catalyst may be due to its ability to reduce the activation energy required for the reaction. Diphenylsilanediol is an important material used to manufacture silicone resins and rubbers. In addition, it is helpful as an additive for organopolysiloxanes that are convertible to the cured solid.
용도
Diphenylsilanediol is used in Medicine field, electronics industry and polymer material.
일반 설명
Diphenylsilanediol(DPSD) is an alkoxysilane that is used as a silane based precusor in the synthesis of organosiloxane based resins.