Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디메틸-p-니트로페닐포스페이트
디메틸-p-니트로페닐포스페이트 · PARAOXON-METHYL · dimethyl-4-nitrophenylphosphate · bay11678 · BAY 11678 · Methyl-E 600 · methyl-e-600 · Paraoxon-Methy
식별자 및 물리적 특성
| CAS No. | 950-35-6 |
|---|---|
| 분자식 | C8H10NO6P |
| 평균 분자량 | 247.14 g/mol |
| 단동위원소 질량 | 247.02457404 g/mol |
| SMILES | COP(=O)(OC)Oc1ccc([N+](=O)[O-])cc1 |
| InChIKey | BAFQDKPJKOLXFZ-UHFFFAOYSA-N |
| PubChem CID | 13708 |
| ChEMBL | CHEMBL26115 |
| ChEBI | CHEBI:165199 |
| EC No. | 625-061-6 |
| DTXSID | DTXSID5037571 |
| 현지명 | 디메틸-p-니트로페닐포스페이트 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 90.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 275 |
| 농약 | Pesticide degradation product |
| LogP(분배 계수) | 1.33 |
| Human Drugs | Pharmaceuticals |
| 녹는점 | 0-4 °C |
| 끓는 점 | 164 °C(Press: 10 Torr) |
| 밀도 | 1.383±0.06 g/cm3(Predicted) |
| 굴절률 | n20/D 1.523 |
| 인화점 | 100 °C |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 색상 | 연한 노란색에서 밝은 노란색까지 |
| BRN | 1884904 |
| 헨리 상수 | 1.1×104 mol/(m3Pa) at 25℃, Woodrow et al. (1990) |
| 주요 응용 | 농업환경 |
| InChI | 1S/C8H10NO6P/c1-13-16(12,14-2)15-8-5-3-7(4-6-8)9(10)11/h3-6H,1-2H3 |
| InChIKey | BAFQDKPJKOLXFZ-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1ccc(cc1)[N+]([O-])=O |
| EPA | Methyl paraoxon (950-35-6) |
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 2.4% (1 of 42) of reports.DangerH300 (97.6%): Fatal if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 1 (97.6%) |
| Acute Exposure Guideline Levels (AEGLs) | The compound is currently at the Holding Status AEGLs which have been reviewed by the NAC/AEGL Committee and are on hold due to insufficient data to develop AEGL values. |
| AEGLs Notes | AEGLs Status: Holding |
| USGS Health-Based Screening Levels for Evaluating Water-Quality | Paraoxon-methylPesticide degradation productSmith, C.D. and Nowell, L.H., 2024. Health-Based Screening Levels for evaluating water-quality data (3rd ed.). DOI:10.5066/F71C1TWP |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | TC5250000 |
| 운송 번호(UN) | 3018 |
| 위험 문구(R) | 28 |
| 위험 표시 | T+ |
| 안전 문구(S) | 28-36/37-45 |
| 포장분류 | I |
| 위험 등급 | 6.1(a)Acute Tox. 1 DermalAcute Tox. 1 InhalationAcute Tox. 1 OralAquatic Acute 1Aquatic Chronic 1STOT RE 1 |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
Methylparaoxon is used in esterase detoxication of acetylcholinesterase inhibitor pesticides using human liver samples in vitro.