Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-((1R,3R,4R)-4-Hydroxy-3-methoxycyclohexyl)-2-methylacrylaldehyde, (E)-
Q27276055 · D3TG17VNO3 · UNII-D3TG17VNO3 · tacrolimus - methacrolein · Tacrolimus Impurity 13 HCl · Tacrolmius methylacryl Aldehyde · TacroliMus Methyl Acryl Aldehyde · Methoxycyclohexanol methacrylic aldehyde
식별자 및 물리적 특성
| CAS No. | 109466-74-2 |
|---|---|
| 분자식 | C11H18O3 |
| 평균 분자량 | 198.26 g/mol |
| 단동위원소 질량 | 198.12559443 g/mol |
| SMILES | CO[C@@H]1C[C@H](/C=C(\C)C=O)CC[C@H]1O |
| InChIKey | ZTXGCGOIEHBZMQ-OJHBQYHASA-N |
| PubChem CID | 13819084 |
| EC No. | 806-465-3 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 223 |
| 녹는점 | 68-71°C |
| 끓는 점 | 322.1±42.0 °C(Predicted) |
| 밀도 | 1.05±0.1 g/cm3(Predicted) |
| 저장 조건 | Amber Vial, -20°C Freezer, Under inert atmosphere |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 14.46±0.60(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| 안정성 | 감광성 |
| 주요 응용 | 소분자 약용 |
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P262, P264, P270, P271, P280, P284, P301+P316, P302+P352, P304+P340, P316, P320, P321, P330, P361+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2Skin Sens. 1A |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Tacrolimus Methyl Acryl Aldehyde is the degradation product of Tacrolimus (F370000), a novel macrocyclic lactone isolated from Streptomyces tsukubaensis, having immunosuppressant activity.