Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-벤질옥시인돌
5-벤질옥시인돌 · NSC 62895 · bredreck`s · 5-Benzyindole · 5-BENZYLOXYINDOLE · 5-benzyloxy-indol · Benzyloxy-5 indole · BENZYLOXYINDOLE(5-)
식별자 및 물리적 특성
| CAS No. | 1215-59-4 |
|---|---|
| 분자식 | C15H13NO |
| 평균 분자량 | 223.27 g/mol |
| 단동위원소 질량 | 223.09971404 g/mol |
| SMILES | c1ccc(COc2ccc3[nH]ccc3c2)cc1 |
| InChIKey | JCQLPDZCNSVBMS-UHFFFAOYSA-N |
| PubChem CID | 14624 |
| ChEMBL | CHEMBL1288719 |
| EC No. | 214-930-1 |
| DTXSID | DTXSID80153285 |
| 현지명 | 5-벤질옥시인돌 |
화학 및 물리적 성질
| XLogP | 3.6 |
|---|---|
| 극성 표면적 | 25 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 237 |
| 녹는점 | 100-104 °C (lit.) |
| 끓는 점 | 364.56°C (rough estimate) |
| 밀도 | 1.0707 (rough estimate) |
| 굴절률 | 1.5500 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 에탄올: 흐릿한 노란색일 수 있음 |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 16.63±0.30(Predicted) |
| 색상 | 흰색에서 밝은 노란색 |
| BRN | 173532 |
| InChI | InChI=1S/C15H13NO/c1-2-4-12(5-3-1)11-17-14-6-7-15-13(10-14)8-9-16-15/h1-10,16H,11H2 |
| InChIKey | JCQLPDZCNSVBMS-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OCC3=CC=CC=C3)C=C2)C=C1 |
| NIST | 1H-indole, 5-(phenylmethoxy)-(1215-59-4) |
화학적 성질
Off-white to beige powder
안전 및 규제
| GHS 분류 | DangerH228 (10%): Flammable solid [Danger Flammable solids]P210, P240, P241, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 10 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Sol. 1 (10%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | NL4850000 |
| 관세 코드 | 29339990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-24/25-22 |
| 위험 등급 | IRRITANT |
| F 고인화성물질 | 8-10 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Reactant in regio- and stereoselective morpholine-catalyzed direct C-3 alkenylation with α,β-unsaturated aldehydes Reactant in selective debenzylation of protective groups using SiliaCat-palladium under mild reaction conditions Reactant in metal-free Friedel-Crafts alkylation reactions Reactant in preparation of protein kinase (PKC) inhibitors Reactant in preparation of indole/quinoline carbothioic acid amide derivatives.