식별자 및 물리적 특성
| CAS No. | 33711-43-2 |
|---|
| 분자식 | C14H24O |
|---|
| 평균 분자량 | 208.34 g/mol |
|---|
| 단동위원소 질량 | 208.18271539 g/mol |
|---|
| SMILES | CC1C(C)(C)C2=C(C(O)CCC2)C1(C)C |
|---|
| InChIKey | TYCUOMHJQBSOBZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 14817841 |
|---|
| EC No. | 801-670-4 |
|---|
| DTXSID | DTXSID00564374 |
|---|
화학 및 물리적 성질
| XLogP | 2.9 |
|---|
| 극성 표면적 | 20.2 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 1 |
|---|
| 회전 가능 결합 수 | 0 |
|---|
| 무거운 원자 수 | 15 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 309 |
|---|
안전 및 규제
| GHS 분류 | WarningH373 (100%): May causes damage to organs through prolonged or repeated exposure [Warning Specific target organ toxicity, repeated exposure]P260, P273, P319, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 11 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | STOT RE 2 (100%) |
|---|
