Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 1490147생성일: 2026년 10월 27일
N-Methyl-3-(trifluoromethyl)benzamide
N-methyl-3-(trifluoromethyl)benzamide · Benzamide, N-methyl-3-(trifluoromethyl)- · N-METHYL-3-(TRIFLUOROMETHYL)BENZENECARBOXAMIDE
https://huagongshe.com/ko/chemical/1490147
식별자 및 물리적 특성
| CAS No. | 41882-19-3 |
|---|
| 분자식 | C9H8F3NO |
|---|
| 평균 분자량 | 203.16 g/mol |
|---|
| 단동위원소 질량 | 203.05579854 g/mol |
|---|
| SMILES | CNC(=O)c1cccc(C(F)(F)F)c1 |
|---|
| InChIKey | ORKXMOMDYXMMNG-UHFFFAOYSA-N |
|---|
| PubChem CID | 1490147 |
|---|
| EC No. | 668-049-6 |
|---|
| DTXSID | DTXSID701288315 |
|---|
화학 및 물리적 성질
| XLogP | 2.7 |
|---|
| 극성 표면적 | 29.1 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 1 |
|---|
| 무거운 원자 수 | 14 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 215 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P272, P280, P301+P317, P302+P352, P305+P351+P338, P321, P330, P333+P317, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 66 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
