Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
트리메틸실릴메틸아지드
트리메틸실릴메틸아지드 · DK939 · DKSI087 · DKFELEX0251 · RIMETHYLSILYLMETHYL AZIDE · AZIDOMETHYLTRIMETHYLSILANE · Trimethylsilylmethyl azide · Silyl Methyl azide triMethyl
식별자 및 물리적 특성
| CAS No. | 87576-94-1 |
|---|---|
| 분자식 | C4H11N3Si |
| 평균 분자량 | 129.24 g/mol |
| 단동위원소 질량 | 129.07222388 g/mol |
| SMILES | C[Si](C)(C)CN=[N+]=[N-] |
| InChIKey | HKBUFTCADGLKAS-UHFFFAOYSA-N |
| PubChem CID | 150751 |
| EC No. | 677-362-7 |
| DTXSID | DTXSID40236487 |
| 현지명 | 트리메틸실릴메틸아지드 |
화학 및 물리적 성질
| 극성 표면적 | 14.4 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 109 |
| 끓는 점 | 92-95°C |
| 밀도 | 0,87 g/cm3 |
| 굴절률 | 1.4300 to 1.4340 |
| 인화점 | 6°C |
| 용해도 | 유기 용매에 용해되고 물에 용해되지 않음 |
| 물리적 상태 | 투명한 액체 |
| 색상 | Colorless to Yellow to Green |
| 비중 | 0.87 |
| InChI | InChI=1S/C4H11N3Si/c1-8(2,3)4-6-7-5/h4H2,1-3H3 |
| InChIKey | HKBUFTCADGLKAS-UHFFFAOYSA-N |
| SMILES | C(N=[N+]=[N-])[Si](C)(C)C |
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 운송 번호(UN) | 1992 |
| 관세 코드 | 2931900090 |
| 위험 문구(R) | 11-23/24/25 |
| 안전 문구(S) | 16-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 3 |
용도
용도
Trimethylsilylmethyl Azide is used in the amination of organometallic compounds; preparation of heterocyclic compounds; precursor of azomethine ylide, reactant in Silylmethyl-Substituted Heterocumulenes and [3 + 2] Cycloaddition etc.
제조 및 합성 방법
제조 방법
Obtained in high yield by reaction of sodium azide and (chloromethyl)trimethylsilane in DMF or HMPA at 80°C.