Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N,N'-1,8-Octanediylbis(2,2-dichloroacetamide)
SKL878 · r-010-tk · win18441 · win18446 · win18,446 · NSC 59354 · bisdiamine · FERTILYSIN
식별자 및 물리적 특성
| CAS No. | 1477-57-2 |
|---|---|
| 분자식 | C12H20Cl4N2O2 |
| 평균 분자량 | 366.1 g/mol |
| 단동위원소 질량 | 364.027889 g/mol |
| SMILES | O=C(NCCCCCCCCNC(=O)C(Cl)Cl)C(Cl)Cl |
| InChIKey | FAOMZVDZARKPFJ-UHFFFAOYSA-N |
| PubChem CID | 15134 |
| ChEMBL | CHEMBL3276621 |
| ChEBI | CHEBI:90441 |
| EC No. | 216-033-0 |
| DTXSID | DTXSID80163783 |
화학 및 물리적 성질
| XLogP | 4.1 |
|---|---|
| 극성 표면적 | 58.2 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 11 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 261 |
| 녹는점 | 118-120 °C |
| 끓는 점 | 530℃ |
| 밀도 | 0.726 |
| 굴절률 | 1.6200 (estimate) |
| 인화점 | 275℃ |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | 아세톤(아주 약간), DMSO(약간 용해됨), 메탄올(약간 용해됨, 가열, 초음파 처리) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 12.28±0.46(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | 1S/C12H20Cl4N2O2/c13-9(14)11(19)17-7-5-3-1-2-4-6-8-18-12(20)10(15)16/h9-10H,1-8H2,(H,17,19)(H,18,20) |
| InChIKey | FAOMZVDZARKPFJ-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCCCCCNC(C(Cl)Cl)=O)C(Cl)Cl |
화학적 성질
white crystalline powder
안전 및 규제
| GHS 분류 | WarningH312 (100%): Harmful in contact with skin [Warning Acute toxicity, dermal]P203, P261, P271, P280, P302+P352, P304+P340, P317, P318, P321, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 독성 | LD50 orally in mice: >16000 mg/kg (Coulston) |
| 위험 문구(R) | 20/21/22-40 |
| 위험 표시 | Xn |
| 안전 문구(S) | 24/25-45-36 |
| 위험 등급 | Acute Tox. 4 DermalAcute Tox. 4 InhalationCarc. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Win 18446 was shown to inhibit the biosynthesis of retinoic acid from retinol in neonatal and adult murine testis and in the embryonic murine gonad.