Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Butylphenol
butylphenol · 4-N-BUTYLPHENOL · 4PO · P-BUTYLPHENOL · 4-butyl-pheno · 4-BUTYLPHENOL · phenol,p-butyl · Phenol,p-butyl-
식별자 및 물리적 특성
| CAS No. | 1638-22-8 |
|---|---|
| 분자식 | C10H14O |
| 평균 분자량 | 150.22 g/mol |
| 단동위원소 질량 | 150.10446507 g/mol |
| SMILES | CCCCc1ccc(O)cc1 |
| InChIKey | CYYZDBDROVLTJU-UHFFFAOYSA-N |
| PubChem CID | 15420 |
| ChEMBL | CHEMBL152295 |
| ChEBI | CHEBI:34437 |
| EC No. | 216-672-5 |
| DTXSID | DTXSID3047425 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 93 |
| Kovats Retention Index | 1360.61361.81364.4133513862360 |
| Collision Cross Section | 140.6 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID3047425] |
| 녹는점 | 22°C |
| 끓는 점 | 138-139°C 18mm |
| 밀도 | 0,98 g/cm3 |
| 굴절률 | 1.5170 |
| 인화점 | 245°C |
| 저장 조건 | RT, stored under nitrogen |
| pKa(산도 계수) | 10.11±0.13(Predicted) |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색~갈색 |
| 용해도 | 물과 섞이지 않습니다. |
| BRN | 2042120 |
| InChI | InChI=1S/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| InChIKey | CYYZDBDROVLTJU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCCC)C=C1 |
| NIST | Phenol, 4-butyl-(1638-22-8) |
| EPA | p-Butylphenol (1638-22-8) |
화학적 성질
liquid
안전 및 규제
| GHS 분류 | DangerH302 (30.4%): Harmful if swallowed [Warning Acute toxicity, oral]H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]H318 (28.1%): Causes serious eye damage [Danger Serious eye damage/eye irritation]P260, P264, P264+P265, P270, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P330, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 135 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. For more detailed information, please visit ECHA C&L website. |
|---|---|
| 규제 정보 | Chemical: Phenol, 4-butyl- |
| 기타 안전 정보 | Evaluation - Propyl and butyl phenols |
| Hazard Classes and Categories | Acute Tox. 4 (30.4%)Skin Corr. 1B (100%)Eye Dam. 1 (28.1%) |
| 수질 위해 등급(WGK) | WGK 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SJ8922500 |
| 운송 번호(UN) | 3145 |
| 관세 코드 | 2907199090 |
| 위험 문구(R) | 20/21/22-36/37/38-41-34-22 |
| 위험 표시 | C,Xn |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 8Acute Tox. 4 OralEye Dam. 1Skin Corr. 1B |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
Intermediates of Liquid Crystals