Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
트리메틸인돌레닌-2,3,3
2,3,3-트라이메틸인돌닌 · 2,3,3-트리메틸인돌닌 · 트리메틸인돌레닌-2,3,3 · 2,3,3-트라이메틸인돌레닌 · 2,3,3-트리메틸인돌레닌 · 2,3,3-TRIMETHYL-3H-INDOLE · Indolenine · 2,3,3-Trimethylindoline
식별자 및 물리적 특성
| CAS No. | 1640-39-7 |
|---|---|
| 분자식 | C11H13N |
| 평균 분자량 | 159.23 g/mol |
| 단동위원소 질량 | 159.10479942 g/mol |
| SMILES | CC1=Nc2ccccc2C1(C)C |
| InChIKey | FLHJIAFUWHPJRT-UHFFFAOYSA-N |
| PubChem CID | 15427 |
| ChEMBL | CHEMBL2393311 |
| EC No. | 216-685-6 |
| DTXSID | DTXSID9049403 |
| 현지명 | 트리메틸인돌레닌-2,3,3 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 12.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 215 |
| 물질 분류 | Nitrogen Compounds -> Other Aromatics (Nitrogen) |
| Physical Description | Yellow or orange liquidmp = 6-8 deg C[Alfa Aesar MSDS] |
| 녹는점 | 6-8°C |
| 끓는 점 | 228-229 °C744 mm Hg(lit.) |
| 밀도 | 0.992 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.549(lit.) |
| 인화점 | 200 °F |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 클로로포름, 톨루엔 또는 디클로로벤젠에 용해됩니다. |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 6.33±0.40(Predicted) |
| 색상 | 투명한 노란색에서 적갈색까지 |
| BRN | 119740 |
| InChI | InChI=1S/C11H13N/c1-8-11(2,3)9-6-4-5-7-10(9)12-8/h4-7H,1-3H3 |
| InChIKey | FLHJIAFUWHPJRT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C)(C)C=1C |
| NIST | 3H-Indole, 2,3,3-trimethyl-(1640-39-7) |
| EPA | 3H-Indole, 2,3,3-trimethyl- (1640-39-7) |
화학적 성질
clear yellow to red-brown liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 54 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 3H-Indole, 2,3,3-trimethyl-Status: Active Update: 20-03-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/23130 |
| 유해성 요약 | An irritant[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 1 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | NA 1993 / PGIII |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 기존화학 물질 | KE-34577 |
| F 고인화성물질 | 10 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2,3,3-Trimethylindolenine is an indole derivative used in the preparation of cyanine dye labelleing reagents and other imaging agents.