9-Anthraceneboronic 산
9-Anthraceneboronic산 · Anthracen-9-ylboronic acid · 9-Anthracenylboronic acid · ANTHRACENE-9-BORONIC ACID · DKI84 · CAS:100622-34-2 · 9-Boronoanthracene · 9-Anthracenylboronic
식별자 및 물리적 특성
| CAS No. | 100622-34-2 |
|---|---|
| 분자식 | C14H11BO2 |
| 평균 분자량 | 222.05 g/mol |
| 단동위원소 질량 | 222.08520999 g/mol |
| SMILES | OB(O)c1c2ccccc2cc2ccccc12 |
| InChIKey | VHHDLIWHHXBLBK-UHFFFAOYSA-N |
| PubChem CID | 15510213 |
| EC No. | 626-419-4 |
| DTXSID | DTXSID80573500 |
| 현지명 | 9-Anthraceneboronic 산 |
화학 및 물리적 성질
| 극성 표면적 | 40.5 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 247 |
| 녹는점 | 203-250 °C |
| 끓는 점 | 479.5±28.0 °C(Predicted) |
| 밀도 | 1.26±0.1 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| pKa(산도 계수) | 8.53±0.30(Predicted) |
| 물리적 상태 | 결정질 고체 |
| 색상 | 흰색에서 황갈색까지 |
| BRN | 3301031 |
| InChI | InChI=1S/C14H11BO2/c16-15(17)14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9,16-17H |
| InChIKey | VHHDLIWHHXBLBK-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2)C=CC=C3)=CC=C1B(O)O |
화학적 성질
Tan solid
안전 및 규제
| GHS 분류 | DangerH301 (93.2%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (93.2%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | No |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 36/37/38-25 |
| 위험 표시 | T |
| 안전 문구(S) | 26-36-45 |
| 포장분류 | Ⅲ |
| 위험 등급 | 6.1Acute Tox. 3 Oral |
| 저장 분류 | 6.1D - Non-combustible acute toxic Cat.3toxic hazardous materials or hazardous materials causing chronic effects |
용도
개요
9-Anthraceneboronic acid is a boronic acid compound mainly used as an organic synthesis and reaction reagent. The addition of 9-Anthraceneboronic acid introduces a borate ester bond and an anthracene functional group into ordinary polyvinyl alcohol, which can be used to prepare the composite material poly(vinyl alcohol) anthraceneboronic acid (PVA-ABA), which is suitable for sustainable engineering applications due to its high mechanical strength and toughness, good water resistance, chemical durability, and ease of recycling. It can also be used to prepare stimuli-responsive polymeric materials and highly efficient luminescent materials.
용도
suzuki reaction