Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5,5'-Dimethyl-2,2'-bipyridyl
Abametapir · 5,5'-Dimethyl-2,2'-bipyridine · 5,5’-dimethyl-2’-bipyridine · HA-44 · Xeglyze · abametapi · BRN 0123183 · Dimethylbipyridyl
식별자 및 물리적 특성
| CAS No. | 1762-34-1 |
|---|---|
| 분자식 | C12H12N2 |
| 평균 분자량 | 184.24 g/mol |
| 단동위원소 질량 | 184.10004839 g/mol |
| SMILES | Cc1ccc(-c2ccc(C)cn2)nc1 |
| InChIKey | PTRATZCAGVBFIQ-UHFFFAOYSA-N |
| PubChem CID | 15664 |
| ChEMBL | CHEMBL2205807 |
| ChEBI | CHEBI:192617 |
| EC No. | 629-235-2 |
| DTXSID | DTXSID00170095 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 25.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 161 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| Human Drugs | FDA approved drugs -> Active ingredient |
| 녹는점 | 114-117 °C(lit.) |
| 끓는 점 | 140℃/3mm |
| 밀도 | 1.060±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMF: 15mg/mL,DMSO: 10mg/mL,Ethanol: 15mg/mL,Ethanol:PBS (pH 7.2) (1:4): 0.2mg/mL |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 4.78±0.32(Predicted) |
| 색상 | 흰색에서 노란색, 주황색으로 |
| InChI | InChI=1S/C12H12N2/c1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12/h3-8H,1-2H3 |
| InChIKey | PTRATZCAGVBFIQ-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=C(C)C=C2)=NC=C(C)C=C1 |
안전 및 규제
| GHS 분류 | WarningH302 (88.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (88.9%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DW1766000 |
| 독성 | mouse,LD50,intraperitoneal,225mg/kg (225mg/kg),Toxicon. Vol. 23, Pg. 815, 1985. |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
5,5'-Dimethyl-2,2'-bipyridine is widely used as an intermediate in organic synthesis and pharmaceuticals. It is also used as a raw material in the synthesis of dyestuffs and agrochemicals. It is used as a precursor for the preparation of 5-methyl-5'vinyl-2,2'-bipyridine.