Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-디메틸옥탄
2,6-디메틸옥탄 · 2,6-다이메틸옥테인 · 2,6-디메틸렌 · dimethyloctane · Octane, 2,6-dimethyl- · 2,6-Dimethyloctane · octane,2,6-dimethyl- · tetrahydrocitronellene
식별자 및 물리적 특성
| CAS No. | 2051-30-1 |
|---|---|
| 분자식 | C10H22 |
| 평균 분자량 | 142.28 g/mol |
| 단동위원소 질량 | 142.1721507 g/mol |
| SMILES | CCC(C)CCCC(C)C |
| InChIKey | ZALHPSXXQIPKTQ-UHFFFAOYSA-N |
| PubChem CID | 16319 |
| EC No. | 623-659-1 |
| DTXSID | DTXSID7058628 |
| 현지명 | 2,6-디메틸옥탄 |
화학 및 물리적 성질
| XLogP | 5.1 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 64.4 |
| Solvents | Solvents -> Aliphatics, Saturated (<C12) |
| Physical Description | Very faintly yellow liquid[Sigma-Aldrich MSDS] |
| 녹는점 | -53.15°C |
| 끓는 점 | 158°C |
| 밀도 | 0,73 g/cm3 |
| 굴절률 | 1.3990-1.4130 |
| 인화점 | 34°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| 용해도 | 89.16ug/L(온도 미공개) |
| 헨리 상수 | 1.0×10-6 mol/(m3Pa) at 25℃, Yaws (2003) |
| InChI | InChI=1S/C10H22/c1-5-10(4)8-6-7-9(2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | ZALHPSXXQIPKTQ-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CC |
| LogP(분배 계수) | 5.490 (est) |
| EPA | Octane, 2,6-dimethyl- (2051-30-1) |
화학적 성질
2,6-Dimethyloctane is a colourless, transparent liquid compound with a density of 0.73 g/mL3, a boiling point of 158° C, a flash point of 34 °C, soluble in ethanol and stored at room temperature.
안전 및 규제
| GHS 분류 | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Octane, 2,6-dimethyl-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| 유해성 요약 | May cause irritation[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 유해 작용 | Neurotoxin - Acute solvent syndrome |
| 운송 번호(UN) | 3295 |
| 관세 코드 | 2901.10.5000 |
| 위험 문구(R) | 10 |
| 안전 문구(S) | 16 |
| 포장분류 | III |
| 위험 등급 | 3 |
| 기존화학 물질 | KE-11625 |
용도
용도
Myrcane is a useful synthetic intermediate. It was used to synthesize alcohols via C-H hydroxylation of alicyclic and aliphatics compounds.