Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-니트로피라졸
4-니트로피라졸 · 4-NITRO-1H-PYRAZOLE · AKOS B001469 · 4-Notropyrazole · 4-NITROPYRAZOLE · 4-nitro-pyrazol · VITAS-BB TBB000667 · 4-nitro-1h-pyrazol
식별자 및 물리적 특성
| CAS No. | 2075-46-9 |
|---|---|
| 분자식 | C3H3N3O2 |
| 평균 분자량 | 113.08 g/mol |
| 단동위원소 질량 | 113.02252634 g/mol |
| SMILES | O=[N+]([O-])c1cn[nH]c1 |
| InChIKey | XORHNJQEWQGXCN-UHFFFAOYSA-N |
| PubChem CID | 16376 |
| EC No. | 629-226-3 |
| DTXSID | DTXSID10174827 |
| 현지명 | 4-니트로피라졸 |
화학 및 물리적 성질
| XLogP | 0.6 |
|---|---|
| 극성 표면적 | 74.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 99.2 |
| LogP(분배 계수) | 0.59 |
| 녹는점 | 160-164°C |
| 끓는 점 | 323°C(lit.) |
| 밀도 | 1.552±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 9.63±0.50(Predicted) |
| 색상 | 하얀색 |
| InChI | InChI=1S/C3H3N3O2/c7-6(8)3-1-4-5-2-3/h1-2H,(H,4,5) |
| InChIKey | XORHNJQEWQGXCN-UHFFFAOYSA-N |
| SMILES | N1C=C([N+]([O-])=O)C=N1 |
| NIST | 4-NO2-pyrazole(2075-46-9) |
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 2% (1 of 49) of reports.DangerH302 (89.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (89.8%) |
| 수질 위해 등급(WGK) | WGK 3 |
| RTECS 번호 | UQ7880000 |
| 관세 코드 | 29331990 |
| 위험 문구(R) | 22-41 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-39 |
| 위험 등급 | IRRITANTAcute Tox. 4 OralEye Dam. 1 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Nitropyrazole, is a building block for the synthesis of various pharmaceutical compounds, including inhibitors, and therapeutic agents. It can be used for the synthesis of highly selective, brain-penetrant aminopyrazole LRRK2 Inhibitor, as a potentially viable treatment for Parkinson''s disease.