Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Chlorophenyl isothiocyanate
P-CHLOROPHENYL ISOTHIOCYANATE · Sch-20350 · AKOS BBS-00004437 · 4-Chlor-phenyl-isothiocyanat · 4-Chloroisothiocyanatobenzene · 4-CHLOROPHENYL ISOTHIOCYANATE · 4-(Isothiocyanato)chlorobenzene · 4-ChlorophenylIsothiocyanate>4-Chlorophenyl isothiocyate, 99%
식별자 및 물리적 특성
| CAS No. | 2131-55-7 |
|---|---|
| 분자식 | C7H4ClNS |
| 평균 분자량 | 169.63 g/mol |
| 단동위원소 질량 | 168.97529781 g/mol |
| SMILES | S=C=Nc1ccc(Cl)cc1 |
| InChIKey | MZZVFXMTZTVUFO-UHFFFAOYSA-N |
| PubChem CID | 16480 |
| EC No. | 218-358-3 |
| DTXSID | DTXSID70175577 |
화학 및 물리적 성질
| XLogP | 3.9 |
|---|---|
| 극성 표면적 | 44.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 146 |
| SpringerMaterials Properties | Density |
| LogP(분배 계수) | 3.91 |
| 녹는점 | 42-44 °C(lit.) |
| 끓는 점 | 135-136 °C24 mm Hg(lit.) |
| 밀도 | 1.3181 (rough estimate) |
| 굴절률 | 1.6100 (estimate) |
| 인화점 | 110 °C |
| 저장 조건 | Refrigerator (+4°C) |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 밝은 노란색 |
| BRN | 471610 |
| InChI | InChI=1S/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| InChIKey | MZZVFXMTZTVUFO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(N=C=S)C=C1 |
화학적 성질
light yellow crystalline mass
안전 및 규제
| GHS 분류 | DangerH301 (89.6%): Toxic if swallowed [Danger Acute toxicity, oral]P233, P260, P261, P262, P264, P264+P265, P270, P271, P272, P280, P284, P301+P316, P302+P352, P304+P340, P305+P351+P338, P316, P319, P321, P330, P332+P317, P333+P317, P337+P317, P342+P316, P361+P364, P362+P364, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (89.6%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | NX8473000 |
| 운송 번호(UN) | UN 2206 6.1/PG 2 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 23/24-36/37/38-42-42/43-23/24/25 |
| 위험 표시 | T |
| 안전 문구(S) | 22-26-36/37/39-45-36/37 |
| 포장분류 | III |
| 위험 등급 | 8Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 3 OralEye Irrit. 2Resp. Sens. 1Skin Irrit. 2Skin Sens. 1STOT SE 3 |
| F 고인화성물질 | 10-21-19 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
4-Chlorophenyl isothiocyanate has been used in the synthesis of thiosemicarbazides. It was also used as building block for the synthesis of N-alkylated 2-arylaminobenzimidazoles.