Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
베타메타손발러레이트
베타메타손발러레이트 · BETAMETHASONE VALERATE · VALISONE · Betaderm · BETNOVATE · BETHAMETASONE VALERATE · Luxiq · Betoid
식별자 및 물리적 특성
| CAS No. | 2152-44-5 |
|---|---|
| 분자식 | C27H37FO6 |
| 평균 분자량 | 476.6 g/mol |
| 단동위원소 질량 | 476.25741712 g/mol |
| SMILES | CCCCC(=O)O[C@]1(C(=O)CO)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChIKey | SNHRLVCMMWUAJD-SUYDQAKGSA-N |
| PubChem CID | 16533 |
| ChEMBL | CHEMBL1497 |
| ChEBI | CHEBI:31277 |
| EC No. | 218-439-3 |
| DTXSID | DTXSID7022673 |
| 현지명 | 베타메타손발러레이트 |
화학 및 물리적 성질
| XLogP | 3.6 |
|---|---|
| 극성 표면적 | 101 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 34 |
| 형식 전하 | 0 |
| 복잡도 | 957 |
| 의약품 | Pharmaceuticals -> Dermatologicals -> Corticosteroids, dermatological preparations |
| Human Drugs | FDA approved drugs -> Active ingredient |
| Animal Drugs | Active Ingredients (Betamethasone Valerate) -> FDA Greenbook |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 215.5 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID7022673]214 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| 녹는점 | 183-184° |
| 끓는 점 | 598.9±50.0 °C(Predicted) |
| 밀도 | 1.1174 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 물에는 거의 녹지 않으며, 아세톤과 염화메틸렌에는 잘 녹고, 에탄올(96%)에는 녹습니다. |
| pKa(산도 계수) | 12.90±0.70(Predicted) |
| 물리적 상태 | Solid |
| 색상 | 하얀색 |
| Merck | 13,1183 |
| BRN | 4240001 |
| InChIKey | SNHRLVCMMWUAJD-SUYDQAKGSA-N |
| SMILES | [C@]12(C)C[C@@H]([C@]3(F)[C@@]4(C)C=CC(=O)C=C4CC[C@@]3([H])[C@]1([H])C[C@H](C)[C@@]2(C(=O)CO)OC(=O)CCCC)O |&1:0,3,4,6,16,18,21,23,r| |
| EPA | .beta.-Methasone 17-valerate (2152-44-5) |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | DangerH330 (35.6%): Fatal if inhaled [Danger Acute toxicity, inhalation]P203, P260, P264, P270, P271, P273, P280, P284, P304+P340, P316, P318, P319, P320, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 146 reports by companies from 21 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Betamethasone valerate: Does not have an individual approval but may be used under an appropriate group standard |
| 기타 안전 정보 | IMAP assessments - Pregna-1,4-diene-3,20-dione, 9-fluoro-11,21-dihydroxy-16-methyl-17-[(1-oxopentyl)oxy]-, (11.beta.,16.beta.)-: Environment tier I assessment |
| Hazard Classes and Categories | Acute Tox. 2 (35.6%) |
| 수질 위해 등급(WGK) | WGK 2 |
| RTECS 번호 | TU3835000 |
| 독성 | mouse,LD50,intraperitoneal,632mg/kg (632mg/kg),Shikoku Igaku Zasshi. Shikoku Medical Journal. Vol. 29, Pg. 153, 1973. |
| 관세 코드 | 2937229000 |
| 위험 문구(R) | 48 |
| 위험 표시 | Xn |
| 안전 문구(S) | 22-24/25 |
| 위험 등급 | Repr. 1BSTOT RE 2 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |