비스(트리메틸알루미늄)-DABCO(R)부가물,DABAL-Me3,DABAL-트리메틸알루미늄,트리에틸렌디아민비스(트리메틸알루미늄)
비스(트리메틸알루미늄)-DABCO(R)부가물,DABAL-Me3,DABAL-트리메틸알루미늄,트리에틸렌디아민비스(트리메틸알루미늄) · DABAL-Me3 · DABAL-trimethylaluminum · Bis(trimethylaluminum)-DABCO(R) adduct · Triethylenediaminine bis(trimethylaluminum) · 1,4-diazabicyclo[2.2.2]octane,trimethylalumane · DABAL-Me3 (adduct of trimethylaluminum and DABCO) · is(trimethylaluminum)-1，4-diazabicyclo[2.2.2]octane adduct
식별자 및 물리적 특성
| CAS No. | 137203-34-0 |
|---|---|
| 분자식 | C12H30Al2N2 |
| 평균 분자량 | 256.34 g/mol |
| 단동위원소 질량 | 256.20397622 g/mol |
| SMILES | C1CN2CCN1CC2.[CH3][Al]([CH3])[CH3].[CH3][Al]([CH3])[CH3] |
| InChIKey | WSTAITCRSVOCTK-UHFFFAOYSA-N |
| PubChem CID | 16688366 |
| DTXSID | DTXSID20586917 |
| 현지명 | 비스(트리메틸알루미늄)-DABCO(R)부가물,DABAL-Me3,DABAL-트리메틸알루미늄,트리에틸렌디아민비스(트리메틸알루미늄) |
화학 및 물리적 성질
| 극성 표면적 | 6.5 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 69.5 |
| 녹는점 | >250 °C |
| 인화점 | 23°C (73°F) |
| 저장 조건 | Hygroscopic, Room Temperature, Under inert atmosphere |
| 용해도 | 벤젠(약간 용해됨), DMSO(약간 용해됨) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| 안정성 | 흡습성, 수분에 민감하고 산성 수용액에서 불안정함 |
| InChI | 1S/C6H12N2.6CH3.2Al/c1-2-8-5-3-7(1)4-6-8/h1-6H26*1H3 |
| InChIKey | WSTAITCRSVOCTK-UHFFFAOYSA-N |
| SMILES | C[Al-](C)(C)[N+]12CC[N+](CC1)(CC2)[Al-](C)(C)C |
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 운송 번호(UN) | UN 3395 4.3/PG 1 |
| 위험 문구(R) | 14-15-22-36/37/38 |
| 위험 표시 | F,Xn |
| 안전 문구(S) | 16-26-43 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3Water-react 1 |
| 저장 분류 | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
용도
용도
Bis(trimethylaluminum)-DABCO(R) adduct, DABAL-Me3, DABAL-trimethylaluminum, Triethylenediaminine bis(trimethylaluminum) is a non-pyrophoric alternative to trimethylaluminum for use in numerous reactions including methylations of aldehydes and imines, methylations of aryl and vinyl halides, conjugate addition to enones, and amide bond formation.1
일반 설명
Product is air and moisture sensitive. Handle and store under a dry, inert atmosphere.