Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4- (2- 아미노 에틸) -2- 메 톡시 페놀
4-(2-아미노에틸)-2-메톡시페놀 · 4-(2-Aminoethyl)-2-methoxyphenol · Methoxytyramine · 3-Methoxy-4-hydroxyphenethylamine · 3-Methyldopamine · Homovanily amine · 3-Methoxydopamine · Dopamine impurity B
식별자 및 물리적 특성
| CAS No. | 554-52-9 |
|---|---|
| 분자식 | C9H13NO2 |
| 평균 분자량 | 167.2 g/mol |
| 단동위원소 질량 | 167.09462866 g/mol |
| SMILES | COc1cc(CCN)ccc1O |
| InChIKey | DIVQKHQLANKJQO-UHFFFAOYSA-N |
| PubChem CID | 1669 |
| ChEMBL | CHEMBL1160785 |
| ChEBI | CHEBI:1582 |
| EC No. | 611-267-3 |
| DTXSID | DTXSID40862189 |
| 현지명 | 4- (2- 아미노 에틸) -2- 메 톡시 페놀 |
화학 및 물리적 성질
| XLogP | 0.2 |
|---|---|
| 극성 표면적 | 55.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 130 |
| LogP(분배 계수) | -0.08 |
| Physical Description | Solid |
| Collision Cross Section | 146.7 Ų [M+H]+ [CCS Type: DTMethod: single field calibrated with ESI Low Concentration Tuning Mix (Agilent)]146.9 Ų [M+H]+ |
| 녹는점 | 89 °C |
| 끓는 점 | 304.5±27.0 °C(Predicted) |
| 밀도 | 1.126±0.06 g/cm3(Predicted) |
| 저장 조건 | Refrigerator, under inert atmosphere |
| 용해도 | 아세토니트릴(약간 용해됨, 가열), 메탄올(약간 용해됨, 가열), 물(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 9.57±0.31(Predicted) |
| 색상 | 옅은 갈색에서 밝은 갈색까지 |
| 안정성 | 흡습성 |
| InChI | InChI=1S/C9H13NO2/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,11H,4-5,10H2,1H3 |
| InChIKey | DIVQKHQLANKJQO-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCN)C=C1OC |
| NIST | 3-Methoxy-4-hydroxyphenylethyl amine(554-52-9) |
화학적 성질
Grey crystalline powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 3.3% (1 of 30) of reports.WarningH319 (96.7%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)Aggregated GHS information provided per 30 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Active Update: 03-05-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/19202 |
| Hazard Classes and Categories | Eye Irrit. 2 (96.7%) |
| 관세 코드 | 29225090 |