Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-아미노벤조나이트릴
3-아미노벤조나이트릴 · 3-아미노벤조니트릴 · 3-CYANOANILINE · Benzonitrile, m-amino- · M-CYANOANILINE · 3-Cyanophenylamine · 3-AMINOBENZONITRIL · 3-Aminobenonitrile
식별자 및 물리적 특성
| CAS No. | 2237-30-1 |
|---|---|
| 분자식 | C7H6N2 |
| 평균 분자량 | 118.14 g/mol |
| 단동위원소 질량 | 118.05309819 g/mol |
| SMILES | N#Cc1cccc(N)c1 |
| InChIKey | NJXPYZHXZZCTNI-UHFFFAOYSA-N |
| PubChem CID | 16702 |
| ChEMBL | CHEMBL326475 |
| EC No. | 218-800-5 |
| DTXSID | DTXSID90176905 |
| 현지명 | 3-아미노벤조나이트릴 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 49.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 133 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 48-53 °C(lit.) |
| 끓는 점 | 288-290 °C |
| 밀도 | 1.5511 (rough estimate) |
| 굴절률 | 1.5500 (estimate) |
| 인화점 | 112 °C |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | 결정질 고체 |
| pKa(산도 계수) | 2.75(at 25℃) |
| 색상 | 갈색 |
| BRN | 636498 |
| InChI | InChI=1S/C7H6N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,9H2 |
| InChIKey | NJXPYZHXZZCTNI-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(N)=C1 |
| NIST | Benzonitrile, 3-amino-(2237-30-1) |
화학적 성질
BROWN CRYSTALLINE SOLID
안전 및 규제
| GHS 분류 | DangerH302 (92%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P317, P321, P330, P333+P317, P337+P317, P361+P364, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzonitrile, 3-amino-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (92%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | DI2454000 |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29214200 |
| 위험 문구(R) | 20/21/22-43-22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36/37-36-26 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralSkin Sens. 1 |
| 기존화학 물질 | KE-01208 |
| 위험 참고 사항 | Harmful |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Aminobenzonitrile was used in the synthesis of series of 1-substituted-3(5)-(6-methylpyridin-2-yl)-4-(quinoxalin-6-yl)pyrazoles. It was also used in the preparation of highly substituted γ-lactam analogues of a thiazolidinone follicle stimulating hormone receptor agonist.
일반 설명
3-Aminobenzonitrile on condensation reaction with 4-isothiocyanato-4-methyl pentane-2-one gives condensed monocyclic pyrimidine derivatives.