Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,3,5-트리니트로나프탈렌
1,3,5-트리니트로나프탈렌 · 1,3,5-trinitronaphthalene
식별자 및 물리적 특성
| CAS No. | 2243-94-9 |
|---|---|
| 분자식 | C10H5N3O6 |
| 평균 분자량 | 263.165 g/mol |
| 단동위원소 질량 | 263.01783488 g/mol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2cccc([N+](=O)[O-])c2c1 |
| InChIKey | OVYNZJGOWOXAKN-UHFFFAOYSA-N |
| PubChem CID | 16721 |
| DTXSID | DTXSID9075296 |
| 현지명 | 1,3,5-트리니트로나프탈렌 |
화학 및 물리적 성질
| 녹는점 | 124°C |
|---|---|
| 끓는 점 | 406.41°C (rough estimate) |
| 밀도 | 1.5737 (rough estimate) |
| 굴절률 | 1.4830 (estimate) |
| EPA | Naphthalene, 1,3,5-trinitro- (2243-94-9) |
안전 및 규제
| 운송 번호(UN) | 0217 |
|---|---|
| 포장분류 | II |
| 위험 등급 | 1.1D |
용도
용도
Explosive, stabilizer for nitrocellulose.
일반 설명
Melting point about 230°F. May explode under exposure to heat or fire. Primary hazard is blast of an instantaneous explosion, not flying projectiles or fragments.