Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
엔프로필라인
엔프로필라인 · d-4028 · nilyph · Enprofilina · ENPROFYLLINE · ENPROPHYLLINE · Enprofyllilie · Enprofyllinum
식별자 및 물리적 특성
| CAS No. | 41078-02-8 |
|---|---|
| 분자식 | C8H10N4O2 |
| 평균 분자량 | 194.19 g/mol |
| 단동위원소 질량 | 194.08037556 g/mol |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]cnc21 |
| InChIKey | SIQPXVQCUCHWDI-UHFFFAOYSA-N |
| PubChem CID | 1676 |
| ChEMBL | CHEMBL279898 |
| ChEBI | CHEBI:126237 |
| EC No. | 255-201-8 |
| DTXSID | DTXSID9045186 |
| 현지명 | 엔프로필라인 |
화학 및 물리적 성질
| XLogP | 0.3 |
|---|---|
| 극성 표면적 | 78.1 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 268 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| LogP(분배 계수) | -0.20.33 |
| 용해도 | 5.68e+00 g/L>29.1 [ug/mL] (The mean of the results at pH 7.4)DMSO: 용해될 수 있다 |
| 녹는점 | 287-289 °C287 - 289 °C |
| Physical Description | Solid |
| 밀도 | 1.38 g/cm3 |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 10.26±0.20(Predicted) |
| 색상 | 하얀색 |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | UO8439700 |
| 위험 문구(R) | 20/21/22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36 |
용도
개요
3-Propylxanthine is a xanthine derivative that antagonizes adenosine receptors (Kis = 44, 32, and 6.3 μM for A1, A2A, and A2B, respectively) and cAMP phosphodiesterase (Ki = 42 μM). Through these actions, 3-propylxanthine induces smooth muscle relaxation, blocks smooth muscle contraction and VEGF secretion driven by adenosine receptor agonists, and reduces bronchial hyperresponsiveness.
용도
Enprofylline is a xanthine lacking adenosine receptor antagonism.