Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bornanol, 2-methyl-
47523-u · Geosmin&2-Methylisoborneol · 2-Methylisoboreneol · 2-METHYLISOBORNEOLE · 2-methylisoborneol solution · 2-Methylisoborneol Standard · (R)-(+)-EXO-2-METHYLISOBORNEOL · 2-Methylisoborneol in Methanol
식별자 및 물리적 특성
| CAS No. | 2371-42-8 |
|---|---|
| 분자식 | C11H20O |
| 평균 분자량 | 168.28 g/mol |
| 단동위원소 질량 | 168.15141526 g/mol |
| SMILES | CC1(O)CC2CCC1(C)C2(C)C |
| InChIKey | LFYXNXGVLGKVCJ-UHFFFAOYSA-N |
| PubChem CID | 16913 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 221 |
| 녹는점 | 170 °C168 °C |
| Physical Description | Solid |
| 끓는 점 | 208.7±8.0 °C(Predicted) |
| 밀도 | 0.968±0.06 g/cm3(Predicted) |
| 인화점 | 9℃ |
| 저장 조건 | -20°C |
| 용해도 | 클로로포름(약간 용해됨), 에탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 15.43±0.60(Predicted) |
| 색상 | 흰색에서 황백색 왁스 |
| 냄새 | 100.00%에서. 흙 같은 곰팡내 나는 |
| 향취 유형 | 땅의 |
| 헨리 상수 | 8.9×10-2 mol/(m3Pa) at 25℃, \"Omür-\"Ozbek and Dietrich (2005) |
| InChI | 1S/C11H20O/c1-9(2)8-5-6-10(9,3)11(4,12)7-8/h8,12H,5-7H2,1-4H3/t8-,10-,11-/m1/s1 |
| InChIKey | LFYXNXGVLGKVCJ-FBIMIBRVSA-N |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@](C)(O)C2 |
| LogP(분배 계수) | 2.931 (est) |
| EPA | Bicyclo[2.2.1]heptan-2-ol, 1,2,7,7-tetramethyl-, (1R,2R,4R)-rel- (2371-42-8) |
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| 운송 번호(UN) | UN 1230 3/PG 2 |
| 위험 문구(R) | 11-23/24/25-39/23/24/25 |
| 위험 표시 | F,T |
| 안전 문구(S) | 7-16-36/37-45 |
| 위험 등급 | Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 3 OralFlam. Liq. 2STOT SE 1 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
2-Methylisoborneol can be used as a reactant: To prepare N-[(1R,2R,4R)-1,4,7,7-tetramethylbicyclo[2.2.1]hept-2-yl]acetamide by reacting with acetonitrile in the presence of boron trifluoride etherate. In the enantioselective total synthesis of geissoschizine as well as geissoschizol.
일반 설명
2-Methylisoborneol (2-MIB) is a semi-volatile compound, responsible for the undesirable earthy-musty odor in surface water. It can be efficiently degraded by TiO2 photocatalysis. 2-MIB can also be easily adsorbed on granular activated carbon.