Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,5-Dichloropyridine
NSC 60546 · 3,5-CHLOROPYRIDINE · 3,5-dichloro-pyridin · 3.5-Dichloropryidine · 3,5-Dichloripyridine · Dichloropyridine,98% · 3,5-DICHLOROPYRIDINE · 3,5-Dichloroypyridine
식별자 및 물리적 특성
| CAS No. | 2457-47-8 |
|---|---|
| 분자식 | C5H3Cl2N |
| 평균 분자량 | 147.99 g/mol |
| 단동위원소 질량 | 146.96425446 g/mol |
| SMILES | Clc1cncc(Cl)c1 |
| InChIKey | WPGHPGAUFIJVJF-UHFFFAOYSA-N |
| PubChem CID | 17153 |
| EC No. | 219-537-9 |
| DTXSID | DTXSID60179307 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 12.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 68.8 |
| 물질 분류 | Nitrogen Compounds -> Pyridines |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 증기압 | 0.77 [mmHg] |
| Physical Description | White crystalline powder with an unpleasant odor[Alfa Aesar MSDS] |
| 녹는점 | 65-67 °C (lit.) |
| 끓는 점 | 178 °C |
| 밀도 | 1.39 |
| 인화점 | >110°C |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 클로로포름, 에틸아세테이트에 용해됨 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 0.32±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| BRN | 1973 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| InChIKey | WPGHPGAUFIJVJF-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Cl)C=C1Cl |
| NIST | Pyridine, 3,5-dichloro-(2457-47-8) |
화학적 성질
White to yellow powder
안전 및 규제
| GHS 분류 | DangerH302 (97.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Causes somnolence and fatty liver degeneration in intraperitoneal lethal-dose studies of mice (LD50 = 1,180 mg/kg)[RTECS] A skin and strong eye irritantHarmful by ingestion and skin absorption[Alfa Aesar MSDS] See 3-Chloropyridine. |
| Hazard Classes and Categories | Acute Tox. 4 (97.8%) |
| 유해 작용 | Neurotoxin - Other CNS neurotoxin |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | US8575000 |
| 운송 번호(UN) | UN2811 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 22-37/38-41-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-39-36 |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3,5-Dichloropyridine (cas# 2457-47-8) is a compound useful in organic synthesis.