Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 175362생성일: 2026년 11월 1일
폴리(옥시-1,2-에탄디일),.알파.-2,4,6-트리스(2-메틸프로필)페닐-.오메가.-히드록시-
폴리(옥시-1,2-에탄디일),.알파.-2,4,6-트리스(2-메틸프로필)페닐-.오메가.-히드록시- · Poly(oxy-1,2-ethanediyl), .alpha.-2,4,6-tris(2-methylpropyl)phenyl-.omega.-hydroxy-
https://huagongshe.com/ko/chemical/175362
식별자 및 물리적 특성
| CAS No. | 72987-43-0 |
|---|
| 분자식 | C20H34O2 |
|---|
| 평균 분자량 | 306.5 g/mol |
|---|
| 단동위원소 질량 | 306.25588032 g/mol |
|---|
| SMILES | CC(C)Cc1cc(CC(C)C)c(OCCO)c(CC(C)C)c1 |
|---|
| InChIKey | RAPHPTULHMOFBS-UHFFFAOYSA-N |
|---|
| PubChem CID | 175362 |
|---|
| DTXSID | DTXSID80868221 |
|---|
| 현지명 | 폴리(옥시-1,2-에탄디일),.알파.-2,4,6-트리스(2-메틸프로필)페닐-.오메가.-히드록시- |
|---|
화학 및 물리적 성질
| XLogP | 6 |
|---|
| 극성 표면적 | 29.5 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 9 |
|---|
| 무거운 원자 수 | 22 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 265 |
|---|
| EPA | Poly(oxy-1,2-ethanediyl), .alpha.-[2,4,6-tris(2-methylpropyl)phenyl]-.omega.-hydroxy- (72987-43-0) |
|---|
안전 및 규제
| 규제 정보 | Chemical: Poly(oxy-1,2-ethanediyl), .alpha.-[2,4,6-tris(2-methylpropyl)phenyl]-.omega.-hydroxy-FRI - indicates a polymeric substance containing no free-radical initiator in its Inventory name but is considered to cover the designated polymer made with any free-radical initiator regardless of the amount used.Poly(oxy-1,2-ethanediyl), .alpha.-2,4,6-tris(2-methylpropyl)phenyl-.omega.-hydroxy-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
| TSCA 등재 상태 | TSCA listed |
|---|
| 기존화학 물질 | KE-34853 |
|---|
