식별자 및 물리적 특성
| CAS No. | 94293-57-9 |
|---|
| 분자식 | C12H20O2S |
|---|
| 평균 분자량 | 228.35 g/mol |
|---|
| 단동위원소 질량 | 228.11840105 g/mol |
|---|
| SMILES | CC(=S)OC(C)(C)[C@@H]1CCC(C)CC1=O |
|---|
| InChIKey | ICHFAYSVCHABJK-LHIURRSHSA-N |
|---|
| PubChem CID | 175606 |
|---|
| EC No. | 304-949-4 |
|---|
화학 및 물리적 성질
| XLogP | 2.5 |
|---|
| 극성 표면적 | 58.4 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 3 |
|---|
| 무거운 원자 수 | 15 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 271 |
|---|
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 10.4% (12 of 115) of reports.WarningH315 (89.6%): Causes skin irritation [Warning Skin corrosion/irritation]P264, P264+P265, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, and P362+P364 (click each P-code to see the statement)Aggregated GHS information provided per 115 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| 규제 정보 | Chemical: Ethanethioic acid, S-[1-methyl-1-(4-methyl-2-oxocyclohexyl)ethyl] ester |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (89.6%) |
|---|
![S-[1-Methyl-1-(4-methyl-2-oxocyclohexyl)ethyl] ethanethioate 분자 구조식](/img/chemical/175606.png)