식별자 및 물리적 특성
| CAS No. | 682738-42-7 |
|---|
| 분자식 | C10H6F4N2S |
|---|
| 평균 분자량 | 262.23 g/mol |
|---|
| 단동위원소 질량 | 262.01878202 g/mol |
|---|
| SMILES | Nc1nc(-c2cc(F)cc(C(F)(F)F)c2)cs1 |
|---|
| InChIKey | UKJQCMKGJGFQFQ-UHFFFAOYSA-N |
|---|
| PubChem CID | 17774635 |
|---|
| EC No. | 995-496-7 |
|---|
화학 및 물리적 성질
| XLogP | 3.3 |
|---|
| 극성 표면적 | 67.2 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 7 |
|---|
| 회전 가능 결합 수 | 1 |
|---|
| 무거운 원자 수 | 17 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 274 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposureRespiratory tract irritation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%)Skin Irrit. 2 (100%)Eye Irrit. 2A (100%)STOT SE 3 (100%) |
|---|
