Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4-디클로로-1,3,5-트리아진
2,4-디클로로-1,3,5-트리아진 · oro-1,3,5-triazine · Dichloro-s-triazine · 2,4-dichlorotriazine · 2,4-Dichloro-s-triazine · 2,4-DICHLORO-1,3,5-TRIAZINE · 1,3,5-Triazine,2,4-dichloro- · 2,4-Dichloro-1,3,5-triazine>2,4-Dichloro-1,3,5-Triazine pure, 98%
식별자 및 물리적 특성
| CAS No. | 2831-66-5 |
|---|---|
| 분자식 | C3HCl2N3 |
| 평균 분자량 | 149.96 g/mol |
| 단동위원소 질량 | 148.95475239 g/mol |
| SMILES | Clc1ncnc(Cl)n1 |
| InChIKey | OMRXVBREYFZQHU-UHFFFAOYSA-N |
| PubChem CID | 17810 |
| EC No. | 676-236-9 |
| DTXSID | DTXSID10274598 |
| 현지명 | 2,4-디클로로-1,3,5-트리아진 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 38.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 70.9 |
| 녹는점 | 54.0 to 58.0 °C |
| 끓는 점 | 102°C/75mmHg(lit.) |
| 밀도 | 1.612±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Store in freezer, under -20°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -1.24±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C3HCl2N3/c4-2-6-1-7-3(5)8-2/h1H |
| InChIKey | OMRXVBREYFZQHU-UHFFFAOYSA-N |
| SMILES | N1=CN=C(Cl)N=C1Cl |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | DangerH302 (25%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P261, P264, P264+P265, P270, P271, P272, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P333+P317, P337+P317, P342+P316, P362+P364, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (25%) |
| 관세 코드 | 2933698090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39 |
| 위험 등급 | IRRITANT |
용도
용도
2,4-Dichloro-1,3,5-triazine is used as an intermediate in organic synthesis and pharmaceutical intermediates, and it is an intermediate in the preparation of bromhexine impurities.
제조 및 합성 방법
제조 방법
2,4-Dichloro-1,3,5-triazine can be synthesized by halogenation of 1,3,5-Triazine with chlorine.