056-(Ferrocenyl)hexanethiol
FHT · FERROCENYL)HEXANETHIOL · 6-(Ferrocenyl)hexanethiol · 6-(Mercaptohexyl)ferrocene · 056-(FERROCENYL)HEXANETHIOL · Ferrocene,(6-mercaptohexyl)- · 056-(FERROCENYL)HEXANETHIOL ISO 9001：2015 REACH · 056-(FERROCENYL)HEXANETHIOL 134029-92-8
식별자 및 물리적 특성
| CAS No. | 134029-92-8 |
|---|---|
| 분자식 | C16H22FeS |
| 평균 분자량 | 302.3 g/mol |
| 단동위원소 질량 | 302.079157 g/mol |
| SMILES | SCCCCCC[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChIKey | YENJERDZPAXYRX-UHFFFAOYSA-N |
| PubChem CID | 16218378 |
화학 및 물리적 성질
| 극성 표면적 | 1 |
|---|---|
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 107 |
| 끓는 점 | 321-353 °C |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| InChI | 1S/C11H17S.C5H5.Fe/c12-10-6-2-1-3-7-11-8-4-5-9-111-2-4-5-3-1/h4-5,8-9,12H,1-3,6-7,10H21-5H |
| InChIKey | YENJERDZPAXYRX-UHFFFAOYSA-N |
| SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.SCCCCCC[C]2[CH][CH][CH][CH]2 |
화학적 성질
Dark red liquid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 운송 번호(UN) | UN 3334 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
FHT can be used as a SAM on gold substrates to act as an electron transport medium which can be potentially used in bio-electrochemical devices. FHT may also be used to functionalize graphene coated gold surfaces by forming gold-thiol linkages which can be used as electron transfer mediators.
일반 설명
6-(Ferrocenyl)hexanethiol (FHT) is a ferrocenyl alkanethiol that forms a self-assembled monolayer (SAM) where ferrocenyl linkages can facilitate the electron exchange between the coating and the substrate.