Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Dehydroxy Mirabegron Hydrochloride Salt
Mirabegron Deshydroxy HCl · Mirabegron Impurity(Hydrochlorate) · Mirabegron Impurity(Dihydrochloride) · Mirabegron Impurity 11(Hydrochlorate) · Mirabegron Impurity 30(Dihydrochloride) · 2-(2-aminothiazol-4-yl)-N-(4-(2-(phenethylamino)ethyl)phenyl)acetamide hydrochlorate · 2-(2-Amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-phenylethyl)amino]ethyl]phenyl]acetamide Hydrochloride
식별자 및 물리적 특성
| CAS No. | 1581284-79-8 |
|---|---|
| 분자식 | C21H25ClN4OS |
| 평균 분자량 | 417 g/mol |
| 단동위원소 질량 | 416.1437603 g/mol |
| SMILES | Cl.Nc1nc(CC(=O)Nc2ccc(CCNCCc3ccccc3)cc2)cs1 |
| InChIKey | OMRYTBQEBNGRTF-UHFFFAOYSA-N |
| PubChem CID | 165429034 |
화학 및 물리적 성질
| 극성 표면적 | 108 |
|---|---|
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 28 |
| 형식 전하 | 0 |
| 복잡도 | 436 |
| 용해도 | 메탄올(약간 용해됨, 가열), 물(약간 용해됨, 가열) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| 안정성 | 흡습성 |
용도
용도
Dehydroxy Mirabegron is an impurity of Mirabegron (M364900), potent bladder relaxant and reagent for diabetes remedy. It can also be used to effectively identify impurity generated during Mirabegron synthesis, so as to control the quality.